C23H24BrN3 — CID 157337182
5-bromo-2,3-dihydro-1H-inden-4-amine;5-pyridin-4-yl-2,3-dihydro-1H-inden-4-amine (PubChem CID 157337182) has the molecular formula C23H24BrN3 and a molecular weight of 422.37 g/mol. Its IUPAC name is 5-bromo-2,3-dihydro-1H-inden-4-amine;5-pyridin-4-yl-2,3-dihydro-1H-inden-4-amine.
| Compound Name | 5-bromo-2,3-dihydro-1H-inden-4-amine;5-pyridin-4-yl-2,3-dihydro-1H-inden-4-amine |
|---|---|
| PubChem CID | 157337182 |
| Molecular Formula | C23H24BrN3 |
| Molecular Weight | 422.37 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 5-bromo-2,3-dihydro-1H-inden-4-amine;5-pyridin-4-yl-2,3-dihydro-1H-inden-4-amine |
| SMILES | Nc1c(-c2ccncc2)ccc2c1CCC2.Nc1c(Br)ccc2c1CCC2 |
| InChI | InChI=1S/C14H14N2.C9H10BrN/c15-14-12-3-1-2-10(12)4-5-13(14)11-6-8-16-9-7-11;10-8-5-4-6-2-1-3-7(6)9(8)11/h4-9H,1-3,15H2;4-5H,1-3,11H2 |
| InChIKey | BFYSRVPIPSKUBN-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.37 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|