About ethane;formaldehyde;1,1,2,2-tetramethylhydrazine
ethane;formaldehyde;1,1,2,2-tetramethylhydrazine (PubChem CID 157337878) has the molecular formula C7H20N2O
and a molecular weight of 148.25 g/mol. Its IUPAC name is ethane;formaldehyde;1,1,2,2-tetramethylhydrazine.
Molecular Properties
| Compound Name | ethane;formaldehyde;1,1,2,2-tetramethylhydrazine |
| PubChem CID | 157337878 |
| Molecular Formula | C7H20N2O |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.16 |
| IUPAC Name | ethane;formaldehyde;1,1,2,2-tetramethylhydrazine |
| SMILES | C=O.CC.CN(C)N(C)C |
| InChI | InChI=1S/C4H12N2.C2H6.CH2O/c1-5(2)6(3)4;2*1-2/h1-4H3;1-2H3;1H2 |
| InChIKey | BGAZQZOPJKCBNL-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;formaldehyde;1,1,2,2-tetramethylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;formaldehyde;1,1,2,2-tetramethylhydrazine?
The IUPAC name of ethane;formaldehyde;1,1,2,2-tetramethylhydrazine (CID 157337878) is ethane;formaldehyde;1,1,2,2-tetramethylhydrazine.
What is the SMILES notation for ethane;formaldehyde;1,1,2,2-tetramethylhydrazine?
The canonical SMILES for ethane;formaldehyde;1,1,2,2-tetramethylhydrazine is C=O.CC.CN(C)N(C)C.
What is the InChIKey of ethane;formaldehyde;1,1,2,2-tetramethylhydrazine?
The InChIKey is BGAZQZOPJKCBNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12N2.C2H6.CH2O/c1-5(2)6(3)4;2*1-2/h1-4H3;1-2H3;1H2.
What are the key properties of ethane;formaldehyde;1,1,2,2-tetramethylhydrazine?
ethane;formaldehyde;1,1,2,2-tetramethylhydrazine has a molecular weight of 148.25 g/mol, XLogP of 0.87, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;formaldehyde;1,1,2,2-tetramethylhydrazine is sourced from PubChem (CID 157337878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).