C27H28N2O2 — CID 157338833
(1S,16S,18R,20S)-20-ethyl-15-(3-methoxyphenyl)-18-methyl-17-oxa-3,13-diazahexacyclo[11.7.0.02,10.03,18.04,9.016,20]icosa-2(10),4,6,8,14-pentaene (PubChem CID 157338833) has the molecular formula C27H28N2O2 and a molecular weight of 412.53 g/mol. Its IUPAC name is (1S,16S,18R,20S)-20-ethyl-15-(3-methoxyphenyl)-18-methyl-17-oxa-3,13-diazahexacyclo[11.7.0.02,10.03,18.04,9.016,20]icosa-2(10),4,6,8,14-pentaene.
| Compound Name | (1S,16S,18R,20S)-20-ethyl-15-(3-methoxyphenyl)-18-methyl-17-oxa-3,13-diazahexacyclo[11.7.0.02,10.03,18.04,9.016,20]icosa-2(10),4,6,8,14-pentaene |
|---|---|
| PubChem CID | 157338833 |
| Molecular Formula | C27H28N2O2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | (1S,16S,18R,20S)-20-ethyl-15-(3-methoxyphenyl)-18-methyl-17-oxa-3,13-diazahexacyclo[11.7.0.02,10.03,18.04,9.016,20]icosa-2(10),4,6,8,14-pentaene |
| SMILES | CC[C@@]12C[C@@]3(C)O[C@@H]1C(c1cccc(OC)c1)=CN1CCc4c(n3c3ccccc43)[C@@H]12 |
| InChI | InChI=1S/C27H28N2O2/c1-4-27-16-26(2)29-22-11-6-5-10-19(22)20-12-13-28(24(27)23(20)29)15-21(25(27)31-26)17-8-7-9-18(14-17)30-3/h5-11,14-15,24-25H,4,12-13,16H2,1-3H3/t24-,25-,26-,27+/m1/s1 |
| InChIKey | BICNMTVERFSUOZ-CWTOASCOSA-N |
| XLogP | 5.48 |
| TPSA | 26.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |