C22H24N4S — CID 157340258
6-(5,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)-N,N-dimethyl-1,3-benzothiazol-2-amine (PubChem CID 157340258) has the molecular formula C22H24N4S and a molecular weight of 376.53 g/mol. Its IUPAC name is 6-(5,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)-N,N-dimethyl-1,3-benzothiazol-2-amine.
| Compound Name | 6-(5,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)-N,N-dimethyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 157340258 |
| Molecular Formula | C22H24N4S |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 6-(5,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)-N,N-dimethyl-1,3-benzothiazol-2-amine |
| SMILES | Cc1ccc2c(c1)c1c(n2C)CCN(c2ccc3nc(N(C)C)sc3c2)C1 |
| InChI | InChI=1S/C22H24N4S/c1-14-5-8-19-16(11-14)17-13-26(10-9-20(17)25(19)4)15-6-7-18-21(12-15)27-22(23-18)24(2)3/h5-8,11-12H,9-10,13H2,1-4H3 |
| InChIKey | JSQCDOWZPUDNLV-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|