C21H21F4N5O2 — CID 157340367
(9S)-N-(5-fluoro-4-methyl-2-pyridinyl)-5-[(3S)-4,4,4-trifluoro-3-methylbutanoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 157340367) has the molecular formula C21H21F4N5O2 and a molecular weight of 451.42 g/mol. Its IUPAC name is (9S)-N-(5-fluoro-4-methyl-2-pyridinyl)-5-[(3S)-4,4,4-trifluoro-3-methylbutanoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-(5-fluoro-4-methyl-2-pyridinyl)-5-[(3S)-4,4,4-trifluoro-3-methylbutanoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 157340367 |
| Molecular Formula | C21H21F4N5O2 |
| Molecular Weight | 451.42 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | (9S)-N-(5-fluoro-4-methyl-2-pyridinyl)-5-[(3S)-4,4,4-trifluoro-3-methylbutanoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | Cc1cc(NC(=O)N2c3nc(C(=O)C[C@H](C)C(F)(F)F)ccc3N3CC[C@H]2C3)ncc1F |
| InChI | InChI=1S/C21H21F4N5O2/c1-11-7-18(26-9-14(11)22)28-20(32)30-13-5-6-29(10-13)16-4-3-15(27-19(16)30)17(31)8-12(2)21(23,24)25/h3-4,7,9,12-13H,5-6,8,10H2,1-2H3,(H,26,28,32)/t12-,13-/m0/s1 |
| InChIKey | YDUACKUBQQESDI-STQMWFEESA-N |
| XLogP | 4.33 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |