C40H34Cl2N10O4 — CID 157340411
2-(4-aminophenyl)-N-(3-chlorophenyl)imidazo[1,2-a]pyrazin-3-amine;N-(3-chlorophenyl)-2-(4-nitrophenyl)imidazo[1,2-a]pyrazin-3-amine;ethyl acetate (PubChem CID 157340411) has the molecular formula C40H34Cl2N10O4 and a molecular weight of 789.68 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-(3-chlorophenyl)imidazo[1,2-a]pyrazin-3-amine;N-(3-chlorophenyl)-2-(4-nitrophenyl)imidazo[1,2-a]pyrazin-3-amine;ethyl acetate.
| Compound Name | 2-(4-aminophenyl)-N-(3-chlorophenyl)imidazo[1,2-a]pyrazin-3-amine;N-(3-chlorophenyl)-2-(4-nitrophenyl)imidazo[1,2-a]pyrazin-3-amine;ethyl acetate |
|---|---|
| PubChem CID | 157340411 |
| Molecular Formula | C40H34Cl2N10O4 |
| Molecular Weight | 789.68 g/mol |
| Exact Mass | 788.21 |
| IUPAC Name | 2-(4-aminophenyl)-N-(3-chlorophenyl)imidazo[1,2-a]pyrazin-3-amine;N-(3-chlorophenyl)-2-(4-nitrophenyl)imidazo[1,2-a]pyrazin-3-amine;ethyl acetate |
| SMILES | CCOC(C)=O.Nc1ccc(-c2nc3cnccn3c2Nc2cccc(Cl)c2)cc1.O=[N+]([O-])c1ccc(-c2nc3cnccn3c2Nc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C18H12ClN5O2.C18H14ClN5.C4H8O2/c19-13-2-1-3-14(10-13)21-18-17(22-16-11-20-8-9-23(16)18)12-4-6-15(7-5-12)24(25)26;19-13-2-1-3-15(10-13)22-18-17(12-4-6-14(20)7-5-12)23-16-11-21-8-9-24(16)18;1-3-6-4(2)5/h1-11,21H;1-11,22H,20H2;3H2,1-2H3 |
| InChIKey | BGIFFFNDJBTLMA-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 179.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.68 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|