C21H20FNO3 — CID 157341326
methyl (4E)-4-[(4-ethylcyclopenta-1,3-dien-1-yl)methylidene]-1-(2-fluorophenyl)-2-methyl-5-oxopyrrole-3-carboxylate (PubChem CID 157341326) has the molecular formula C21H20FNO3 and a molecular weight of 353.39 g/mol. Its IUPAC name is methyl (4E)-4-[(4-ethylcyclopenta-1,3-dien-1-yl)methylidene]-1-(2-fluorophenyl)-2-methyl-5-oxopyrrole-3-carboxylate.
| Compound Name | methyl (4E)-4-[(4-ethylcyclopenta-1,3-dien-1-yl)methylidene]-1-(2-fluorophenyl)-2-methyl-5-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 157341326 |
| Molecular Formula | C21H20FNO3 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | methyl (4E)-4-[(4-ethylcyclopenta-1,3-dien-1-yl)methylidene]-1-(2-fluorophenyl)-2-methyl-5-oxopyrrole-3-carboxylate |
| SMILES | CCC1=CC=C(/C=C2/C(=O)N(c3ccccc3F)C(C)=C2C(=O)OC)C1 |
| InChI | InChI=1S/C21H20FNO3/c1-4-14-9-10-15(11-14)12-16-19(21(25)26-3)13(2)23(20(16)24)18-8-6-5-7-17(18)22/h5-10,12H,4,11H2,1-3H3/b16-12+ |
| InChIKey | BGKVYSYOBSIMAW-FOWTUZBSSA-N |
| XLogP | 4.21 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|