C55H44BCl2N7O2 — CID 157341769
2,4-bis(4-pyridin-4-ylphenyl)quinazoline;2,4-dichloroquinazoline;4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine (PubChem CID 157341769) has the molecular formula C55H44BCl2N7O2 and a molecular weight of 916.72 g/mol. Its IUPAC name is 2,4-bis(4-pyridin-4-ylphenyl)quinazoline;2,4-dichloroquinazoline;4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine.
| Compound Name | 2,4-bis(4-pyridin-4-ylphenyl)quinazoline;2,4-dichloroquinazoline;4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine |
|---|---|
| PubChem CID | 157341769 |
| Molecular Formula | C55H44BCl2N7O2 |
| Molecular Weight | 916.72 g/mol |
| Exact Mass | 915.30 |
| IUPAC Name | 2,4-bis(4-pyridin-4-ylphenyl)quinazoline;2,4-dichloroquinazoline;4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine |
| SMILES | CC1(C)OB(c2ccc(-c3ccncc3)cc2)OC1(C)C.Clc1nc(Cl)c2ccccc2n1.c1ccc2c(-c3ccc(-c4ccncc4)cc3)nc(-c3ccc(-c4ccncc4)cc3)nc2c1 |
| InChI | InChI=1S/C30H20N4.C17H20BNO2.C8H4Cl2N2/c1-2-4-28-27(3-1)29(25-9-5-21(6-10-25)23-13-17-31-18-14-23)34-30(33-28)26-11-7-22(8-12-26)24-15-19-32-20-16-24;1-16(2)17(3,4)21-18(20-16)15-7-5-13(6-8-15)14-9-11-19-12-10-14;9-7-5-3-1-2-4-6(5)11-8(10)12-7/h1-20H;5-12H,1-4H3;1-4H |
| InChIKey | BGMCHOOLWYJLDV-UHFFFAOYSA-N |
| XLogP | 13.07 |
| TPSA | 108.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 916.72 |
| LogP ≤ 5 | 13.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|