C34H46Br2O8 — CID 157342175
1,2-bis(bromomethyl)benzene;2-O'-tert-butyl 2-O-ethyl 1,3-dihydroindene-2,2-dicarboxylate;3-O-tert-butyl 1-O-ethyl propanedioate (PubChem CID 157342175) has the molecular formula C34H46Br2O8 and a molecular weight of 742.54 g/mol. Its IUPAC name is 1,2-bis(bromomethyl)benzene;2-O'-tert-butyl 2-O-ethyl 1,3-dihydroindene-2,2-dicarboxylate;3-O-tert-butyl 1-O-ethyl propanedioate.
| Compound Name | 1,2-bis(bromomethyl)benzene;2-O'-tert-butyl 2-O-ethyl 1,3-dihydroindene-2,2-dicarboxylate;3-O-tert-butyl 1-O-ethyl propanedioate |
|---|---|
| PubChem CID | 157342175 |
| Molecular Formula | C34H46Br2O8 |
| Molecular Weight | 742.54 g/mol |
| Exact Mass | 740.16 |
| IUPAC Name | 1,2-bis(bromomethyl)benzene;2-O'-tert-butyl 2-O-ethyl 1,3-dihydroindene-2,2-dicarboxylate;3-O-tert-butyl 1-O-ethyl propanedioate |
| SMILES | BrCc1ccccc1CBr.CCOC(=O)C1(C(=O)OC(C)(C)C)Cc2ccccc2C1.CCOC(=O)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H22O4.C9H16O4.C8H8Br2/c1-5-20-14(18)17(15(19)21-16(2,3)4)10-12-8-6-7-9-13(12)11-17;1-5-12-7(10)6-8(11)13-9(2,3)4;9-5-7-3-1-2-4-8(7)6-10/h6-9H,5,10-11H2,1-4H3;5-6H2,1-4H3;1-4H,5-6H2 |
| InChIKey | BGNHORPNSFJEDY-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.54 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|