C17H18N2 — CID 157343287
(1R,9R,13E)-13-ethylidene-5,11-dimethyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,5,10-tetraene-1-carbonitrile (PubChem CID 157343287) has the molecular formula C17H18N2 and a molecular weight of 250.34 g/mol. Its IUPAC name is (1R,9R,13E)-13-ethylidene-5,11-dimethyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,5,10-tetraene-1-carbonitrile.
| Compound Name | (1R,9R,13E)-13-ethylidene-5,11-dimethyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,5,10-tetraene-1-carbonitrile |
|---|---|
| PubChem CID | 157343287 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | (1R,9R,13E)-13-ethylidene-5,11-dimethyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,5,10-tetraene-1-carbonitrile |
| SMILES | C/C=C1\[C@H]2C=C(C)C[C@]1(C#N)c1ccc(C)nc1C2 |
| InChI | InChI=1S/C17H18N2/c1-4-14-13-7-11(2)9-17(14,10-18)15-6-5-12(3)19-16(15)8-13/h4-7,13H,8-9H2,1-3H3/b14-4+/t13-,17+/m0/s1 |
| InChIKey | BGQQUMWEHAREFV-NPYPHWNHSA-N |
| XLogP | 3.62 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|