About 2,3-dihydropyran-6-one;4-(2-nitropropan-2-yl)oxan-2-one
2,3-dihydropyran-6-one;4-(2-nitropropan-2-yl)oxan-2-one (PubChem CID 157343529) has the molecular formula C13H19NO6
and a molecular weight of 285.30 g/mol. Its IUPAC name is 2,3-dihydropyran-6-one;4-(2-nitropropan-2-yl)oxan-2-one.
Molecular Properties
| Compound Name | 2,3-dihydropyran-6-one;4-(2-nitropropan-2-yl)oxan-2-one |
| PubChem CID | 157343529 |
| Molecular Formula | C13H19NO6 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 2,3-dihydropyran-6-one;4-(2-nitropropan-2-yl)oxan-2-one |
| SMILES | CC(C)(C1CCOC(=O)C1)[N+](=O)[O-].O=C1C=CCCO1 |
| InChI | InChI=1S/C8H13NO4.C5H6O2/c1-8(2,9(11)12)6-3-4-13-7(10)5-6;6-5-3-1-2-4-7-5/h6H,3-5H2,1-2H3;1,3H,2,4H2 |
| InChIKey | BGRJHBFXRJSMNE-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydropyran-6-one;4-(2-nitropropan-2-yl)oxan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydropyran-6-one;4-(2-nitropropan-2-yl)oxan-2-one?
The IUPAC name of 2,3-dihydropyran-6-one;4-(2-nitropropan-2-yl)oxan-2-one (CID 157343529) is 2,3-dihydropyran-6-one;4-(2-nitropropan-2-yl)oxan-2-one.
What is the SMILES notation for 2,3-dihydropyran-6-one;4-(2-nitropropan-2-yl)oxan-2-one?
The canonical SMILES for 2,3-dihydropyran-6-one;4-(2-nitropropan-2-yl)oxan-2-one is CC(C)(C1CCOC(=O)C1)[N+](=O)[O-].O=C1C=CCCO1.
What is the InChIKey of 2,3-dihydropyran-6-one;4-(2-nitropropan-2-yl)oxan-2-one?
The InChIKey is BGRJHBFXRJSMNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO4.C5H6O2/c1-8(2,9(11)12)6-3-4-13-7(10)5-6;6-5-3-1-2-4-7-5/h6H,3-5H2,1-2H3;1,3H,2,4H2.
What are the key properties of 2,3-dihydropyran-6-one;4-(2-nitropropan-2-yl)oxan-2-one?
2,3-dihydropyran-6-one;4-(2-nitropropan-2-yl)oxan-2-one has a molecular weight of 285.30 g/mol, XLogP of 1.48, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydropyran-6-one;4-(2-nitropropan-2-yl)oxan-2-one is sourced from PubChem (CID 157343529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).