C31H53NO7 — CID 157344524
6-[(1S,2S,4R)-2,3-dihydroxy-5-(hydroxymethyl)-4-(7-methyl-6-oxooctoxy)cyclohexyl]oxy-N-methyl-N-phenylhexanamide;ethane (PubChem CID 157344524) has the molecular formula C31H53NO7 and a molecular weight of 551.77 g/mol. Its IUPAC name is 6-[(1S,2S,4R)-2,3-dihydroxy-5-(hydroxymethyl)-4-(7-methyl-6-oxooctoxy)cyclohexyl]oxy-N-methyl-N-phenylhexanamide;ethane.
| Compound Name | 6-[(1S,2S,4R)-2,3-dihydroxy-5-(hydroxymethyl)-4-(7-methyl-6-oxooctoxy)cyclohexyl]oxy-N-methyl-N-phenylhexanamide;ethane |
|---|---|
| PubChem CID | 157344524 |
| Molecular Formula | C31H53NO7 |
| Molecular Weight | 551.77 g/mol |
| Exact Mass | 551.38 |
| IUPAC Name | 6-[(1S,2S,4R)-2,3-dihydroxy-5-(hydroxymethyl)-4-(7-methyl-6-oxooctoxy)cyclohexyl]oxy-N-methyl-N-phenylhexanamide;ethane |
| SMILES | CC.CC(C)C(=O)CCCCCO[C@@H]1C(CO)C[C@H](OCCCCCC(=O)N(C)c2ccccc2)[C@@H](O)C1O |
| InChI | InChI=1S/C29H47NO7.C2H6/c1-21(2)24(32)15-9-5-12-18-37-29-22(20-31)19-25(27(34)28(29)35)36-17-11-6-10-16-26(33)30(3)23-13-7-4-8-14-23;1-2/h4,7-8,13-14,21-22,25,27-29,31,34-35H,5-6,9-12,15-20H2,1-3H3;1-2H3/t22?,25-,27+,28?,29+;/m0./s1 |
| InChIKey | BGUIXBXYNAIDPK-OJBBGXJOSA-N |
| XLogP | 4.53 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.77 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|