C27H31F2N5O2 — CID 157344941
1-[3-amino-6-(3-butoxy-2,6-difluorophenyl)-2-pyridinyl]-2-[4-[(3S)-3-aminopiperidin-1-yl]-3-pyridinyl]ethanone (PubChem CID 157344941) has the molecular formula C27H31F2N5O2 and a molecular weight of 495.57 g/mol. Its IUPAC name is 1-[3-amino-6-(3-butoxy-2,6-difluorophenyl)-2-pyridinyl]-2-[4-[(3S)-3-aminopiperidin-1-yl]-3-pyridinyl]ethanone.
| Compound Name | 1-[3-amino-6-(3-butoxy-2,6-difluorophenyl)-2-pyridinyl]-2-[4-[(3S)-3-aminopiperidin-1-yl]-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 157344941 |
| Molecular Formula | C27H31F2N5O2 |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | 1-[3-amino-6-(3-butoxy-2,6-difluorophenyl)-2-pyridinyl]-2-[4-[(3S)-3-aminopiperidin-1-yl]-3-pyridinyl]ethanone |
| SMILES | CCCCOc1ccc(F)c(-c2ccc(N)c(C(=O)Cc3cnccc3N3CCC[C@H](N)C3)n2)c1F |
| InChI | InChI=1S/C27H31F2N5O2/c1-2-3-13-36-24-9-6-19(28)25(26(24)29)21-8-7-20(31)27(33-21)23(35)14-17-15-32-11-10-22(17)34-12-4-5-18(30)16-34/h6-11,15,18H,2-5,12-14,16,30-31H2,1H3/t18-/m0/s1 |
| InChIKey | PPEYKALZEKESMP-SFHVURJKSA-N |
| XLogP | 4.54 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|