About tris(dimethylsilyl) propan-2-yl silicate
tris(dimethylsilyl) propan-2-yl silicate (PubChem CID 157345272) has the molecular formula C9H28O4Si4
and a molecular weight of 312.66 g/mol. Its IUPAC name is tris(dimethylsilyl) propan-2-yl silicate.
Molecular Properties
| Compound Name | tris(dimethylsilyl) propan-2-yl silicate |
| PubChem CID | 157345272 |
| Molecular Formula | C9H28O4Si4 |
| Molecular Weight | 312.66 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | tris(dimethylsilyl) propan-2-yl silicate |
| SMILES | CC(C)O[Si](O[SiH](C)C)(O[SiH](C)C)O[SiH](C)C |
| InChI | InChI=1S/C9H28O4Si4/c1-9(2)10-17(11-14(3)4,12-15(5)6)13-16(7)8/h9,14-16H,1-8H3 |
| InChIKey | RPOIEHRNTZXESI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.66 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tris(dimethylsilyl) propan-2-yl silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(dimethylsilyl) propan-2-yl silicate?
The IUPAC name of tris(dimethylsilyl) propan-2-yl silicate (CID 157345272) is tris(dimethylsilyl) propan-2-yl silicate.
What is the SMILES notation for tris(dimethylsilyl) propan-2-yl silicate?
The canonical SMILES for tris(dimethylsilyl) propan-2-yl silicate is CC(C)O[Si](O[SiH](C)C)(O[SiH](C)C)O[SiH](C)C.
What is the InChIKey of tris(dimethylsilyl) propan-2-yl silicate?
The InChIKey is RPOIEHRNTZXESI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H28O4Si4/c1-9(2)10-17(11-14(3)4,12-15(5)6)13-16(7)8/h9,14-16H,1-8H3.
What are the key properties of tris(dimethylsilyl) propan-2-yl silicate?
tris(dimethylsilyl) propan-2-yl silicate has a molecular weight of 312.66 g/mol, XLogP of 1.85, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tris(dimethylsilyl) propan-2-yl silicate is sourced from PubChem (CID 157345272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).