About 1-hydroxy-6-imino-N,N,2-trimethylpyrimidin-4-amine
1-hydroxy-6-imino-N,N,2-trimethylpyrimidin-4-amine (PubChem CID 15734619) has the molecular formula C7H12N4O
and a molecular weight of 168.20 g/mol. Its IUPAC name is 1-hydroxy-6-imino-N,N,2-trimethylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 1-hydroxy-6-imino-N,N,2-trimethylpyrimidin-4-amine |
| PubChem CID | 15734619 |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 1-hydroxy-6-imino-N,N,2-trimethylpyrimidin-4-amine |
| SMILES | [H]/N=c1\cc(N(C)C)nc(C)n1O |
| InChI | InChI=1S/C7H12N4O/c1-5-9-7(10(2)3)4-6(8)11(5)12/h4,8,12H,1-3H3/b8-6+ |
| InChIKey | RHSHOGGPYZUIML-SOFGYWHQSA-N |
| XLogP | -0.03 |
| TPSA | 65.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-6-imino-N,N,2-trimethylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-6-imino-N,N,2-trimethylpyrimidin-4-amine?
The IUPAC name of 1-hydroxy-6-imino-N,N,2-trimethylpyrimidin-4-amine (CID 15734619) is 1-hydroxy-6-imino-N,N,2-trimethylpyrimidin-4-amine.
What is the SMILES notation for 1-hydroxy-6-imino-N,N,2-trimethylpyrimidin-4-amine?
The canonical SMILES for 1-hydroxy-6-imino-N,N,2-trimethylpyrimidin-4-amine is [H]/N=c1\cc(N(C)C)nc(C)n1O.
What is the InChIKey of 1-hydroxy-6-imino-N,N,2-trimethylpyrimidin-4-amine?
The InChIKey is RHSHOGGPYZUIML-SOFGYWHQSA-N. The full InChI is InChI=1S/C7H12N4O/c1-5-9-7(10(2)3)4-6(8)11(5)12/h4,8,12H,1-3H3/b8-6+.
What are the key properties of 1-hydroxy-6-imino-N,N,2-trimethylpyrimidin-4-amine?
1-hydroxy-6-imino-N,N,2-trimethylpyrimidin-4-amine has a molecular weight of 168.20 g/mol, XLogP of -0.03, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-6-imino-N,N,2-trimethylpyrimidin-4-amine is sourced from PubChem (CID 15734619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).