About 1-ethyl-3-methyl-2H-pyridine;fluoroform
1-ethyl-3-methyl-2H-pyridine;fluoroform (PubChem CID 157346489) has the molecular formula C9H14F3N
and a molecular weight of 193.21 g/mol. Its IUPAC name is 1-ethyl-3-methyl-2H-pyridine;fluoroform.
Molecular Properties
| Compound Name | 1-ethyl-3-methyl-2H-pyridine;fluoroform |
| PubChem CID | 157346489 |
| Molecular Formula | C9H14F3N |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 1-ethyl-3-methyl-2H-pyridine;fluoroform |
| SMILES | CCN1C=CC=C(C)C1.FC(F)F |
| InChI | InChI=1S/C8H13N.CHF3/c1-3-9-6-4-5-8(2)7-9;2-1(3)4/h4-6H,3,7H2,1-2H3;1H |
| InChIKey | BHALDCKUMKQAFP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethyl-3-methyl-2H-pyridine;fluoroform with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-methyl-2H-pyridine;fluoroform?
The IUPAC name of 1-ethyl-3-methyl-2H-pyridine;fluoroform (CID 157346489) is 1-ethyl-3-methyl-2H-pyridine;fluoroform.
What is the SMILES notation for 1-ethyl-3-methyl-2H-pyridine;fluoroform?
The canonical SMILES for 1-ethyl-3-methyl-2H-pyridine;fluoroform is CCN1C=CC=C(C)C1.FC(F)F.
What is the InChIKey of 1-ethyl-3-methyl-2H-pyridine;fluoroform?
The InChIKey is BHALDCKUMKQAFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N.CHF3/c1-3-9-6-4-5-8(2)7-9;2-1(3)4/h4-6H,3,7H2,1-2H3;1H.
What are the key properties of 1-ethyl-3-methyl-2H-pyridine;fluoroform?
1-ethyl-3-methyl-2H-pyridine;fluoroform has a molecular weight of 193.21 g/mol, XLogP of 2.96, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-methyl-2H-pyridine;fluoroform is sourced from PubChem (CID 157346489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).