C39H26N8O6S3 — CID 157347061
2-[hydroxy(1H-indol-3-yl)methyl]-1,3-thiazole-4-carboxamide;2-(1H-indole-3-carbonyl)-1,3-thiazole-4-carbonitrile;2-(1H-indole-3-carbonyl)-1,3-thiazole-4-carboxylic acid (PubChem CID 157347061) has the molecular formula C39H26N8O6S3 and a molecular weight of 798.89 g/mol. Its IUPAC name is 2-[hydroxy(1H-indol-3-yl)methyl]-1,3-thiazole-4-carboxamide;2-(1H-indole-3-carbonyl)-1,3-thiazole-4-carbonitrile;2-(1H-indole-3-carbonyl)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[hydroxy(1H-indol-3-yl)methyl]-1,3-thiazole-4-carboxamide;2-(1H-indole-3-carbonyl)-1,3-thiazole-4-carbonitrile;2-(1H-indole-3-carbonyl)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 157347061 |
| Molecular Formula | C39H26N8O6S3 |
| Molecular Weight | 798.89 g/mol |
| Exact Mass | 798.11 |
| IUPAC Name | 2-[hydroxy(1H-indol-3-yl)methyl]-1,3-thiazole-4-carboxamide;2-(1H-indole-3-carbonyl)-1,3-thiazole-4-carbonitrile;2-(1H-indole-3-carbonyl)-1,3-thiazole-4-carboxylic acid |
| SMILES | N#Cc1csc(C(=O)c2c[nH]c3ccccc23)n1.NC(=O)c1csc(C(O)c2c[nH]c3ccccc23)n1.O=C(O)c1csc(C(=O)c2c[nH]c3ccccc23)n1 |
| InChI | InChI=1S/C13H11N3O2S.C13H7N3OS.C13H8N2O3S/c14-12(18)10-6-19-13(16-10)11(17)8-5-15-9-4-2-1-3-7(8)9;14-5-8-7-18-13(16-8)12(17)10-6-15-11-4-2-1-3-9(10)11;16-11(12-15-10(6-19-12)13(17)18)8-5-14-9-4-2-1-3-7(8)9/h1-6,11,15,17H,(H2,14,18);1-4,6-7,15H;1-6,14H,(H,17,18) |
| InChIKey | BHCBRYOCNQDAFF-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 244.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.89 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |