About 3-methylideneoxolan-2-one;pyrrole-2,5-dione
3-methylideneoxolan-2-one;pyrrole-2,5-dione (PubChem CID 157347209) has the molecular formula C9H9NO4
and a molecular weight of 195.17 g/mol. Its IUPAC name is 3-methylideneoxolan-2-one;pyrrole-2,5-dione.
Molecular Properties
| Compound Name | 3-methylideneoxolan-2-one;pyrrole-2,5-dione |
| PubChem CID | 157347209 |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.17 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 3-methylideneoxolan-2-one;pyrrole-2,5-dione |
| SMILES | C=C1CCOC1=O.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/C5H6O2.C4H3NO2/c1-4-2-3-7-5(4)6;6-3-1-2-4(7)5-3/h1-3H2;1-2H,(H,5,6,7) |
| InChIKey | BHCNLLIZSXNORC-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.17 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-methylideneoxolan-2-one;pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylideneoxolan-2-one;pyrrole-2,5-dione?
The IUPAC name of 3-methylideneoxolan-2-one;pyrrole-2,5-dione (CID 157347209) is 3-methylideneoxolan-2-one;pyrrole-2,5-dione.
What is the SMILES notation for 3-methylideneoxolan-2-one;pyrrole-2,5-dione?
The canonical SMILES for 3-methylideneoxolan-2-one;pyrrole-2,5-dione is C=C1CCOC1=O.O=C1C=CC(=O)N1.
What is the InChIKey of 3-methylideneoxolan-2-one;pyrrole-2,5-dione?
The InChIKey is BHCNLLIZSXNORC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O2.C4H3NO2/c1-4-2-3-7-5(4)6;6-3-1-2-4(7)5-3/h1-3H2;1-2H,(H,5,6,7).
What are the key properties of 3-methylideneoxolan-2-one;pyrrole-2,5-dione?
3-methylideneoxolan-2-one;pyrrole-2,5-dione has a molecular weight of 195.17 g/mol, XLogP of -0.31, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylideneoxolan-2-one;pyrrole-2,5-dione is sourced from PubChem (CID 157347209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).