About 2-[(2-amino-2-pyridin-3-ylethyl)-[2-(butylcarbamoyloxy)ethyl]amino]ethyl N-butylcarbamate
2-[(2-amino-2-pyridin-3-ylethyl)-[2-(butylcarbamoyloxy)ethyl]amino]ethyl N-butylcarbamate (PubChem CID 15734755) has the molecular formula C21H37N5O4
and a molecular weight of 423.56 g/mol. Its IUPAC name is 2-[(2-amino-2-pyridin-3-ylethyl)-[2-(butylcarbamoyloxy)ethyl]amino]ethyl N-butylcarbamate.
Molecular Properties
| Compound Name | 2-[(2-amino-2-pyridin-3-ylethyl)-[2-(butylcarbamoyloxy)ethyl]amino]ethyl N-butylcarbamate |
| PubChem CID | 15734755 |
| Molecular Formula | C21H37N5O4 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.28 |
| IUPAC Name | 2-[(2-amino-2-pyridin-3-ylethyl)-[2-(butylcarbamoyloxy)ethyl]amino]ethyl N-butylcarbamate |
| SMILES | CCCCNC(=O)OCCN(CCOC(=O)NCCCC)CC(N)c1cccnc1 |
| InChI | InChI=1S/C21H37N5O4/c1-3-5-10-24-20(27)29-14-12-26(13-15-30-21(28)25-11-6-4-2)17-19(22)18-8-7-9-23-16-18/h7-9,16,19H,3-6,10-15,17,22H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | IRGGOAYDQRNPBJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-amino-2-pyridin-3-ylethyl)-[2-(butylcarbamoyloxy)ethyl]amino]ethyl N-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-amino-2-pyridin-3-ylethyl)-[2-(butylcarbamoyloxy)ethyl]amino]ethyl N-butylcarbamate?
The IUPAC name of 2-[(2-amino-2-pyridin-3-ylethyl)-[2-(butylcarbamoyloxy)ethyl]amino]ethyl N-butylcarbamate (CID 15734755) is 2-[(2-amino-2-pyridin-3-ylethyl)-[2-(butylcarbamoyloxy)ethyl]amino]ethyl N-butylcarbamate.
What is the SMILES notation for 2-[(2-amino-2-pyridin-3-ylethyl)-[2-(butylcarbamoyloxy)ethyl]amino]ethyl N-butylcarbamate?
The canonical SMILES for 2-[(2-amino-2-pyridin-3-ylethyl)-[2-(butylcarbamoyloxy)ethyl]amino]ethyl N-butylcarbamate is CCCCNC(=O)OCCN(CCOC(=O)NCCCC)CC(N)c1cccnc1.
What is the InChIKey of 2-[(2-amino-2-pyridin-3-ylethyl)-[2-(butylcarbamoyloxy)ethyl]amino]ethyl N-butylcarbamate?
The InChIKey is IRGGOAYDQRNPBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H37N5O4/c1-3-5-10-24-20(27)29-14-12-26(13-15-30-21(28)25-11-6-4-2)17-19(22)18-8-7-9-23-16-18/h7-9,16,19H,3-6,10-15,17,22H2,1-2H3,(H,24,27)(H,25,28).
What are the key properties of 2-[(2-amino-2-pyridin-3-ylethyl)-[2-(butylcarbamoyloxy)ethyl]amino]ethyl N-butylcarbamate?
2-[(2-amino-2-pyridin-3-ylethyl)-[2-(butylcarbamoyloxy)ethyl]amino]ethyl N-butylcarbamate has a molecular weight of 423.56 g/mol, XLogP of 2.44, 15 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-amino-2-pyridin-3-ylethyl)-[2-(butylcarbamoyloxy)ethyl]amino]ethyl N-butylcarbamate is sourced from PubChem (CID 15734755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).