C15H16N4O4S — CID 15734829
[3-[(3R,4S)-3-hydroxy-2,2-dimethyl-6-nitro-3,4-dihydrochromen-4-yl]-1,3-thiazolidin-2-ylidene]cyanamide (PubChem CID 15734829) has the molecular formula C15H16N4O4S and a molecular weight of 348.38 g/mol. Its IUPAC name is [3-[(3R,4S)-3-hydroxy-2,2-dimethyl-6-nitro-3,4-dihydrochromen-4-yl]-1,3-thiazolidin-2-ylidene]cyanamide.
| Compound Name | [3-[(3R,4S)-3-hydroxy-2,2-dimethyl-6-nitro-3,4-dihydrochromen-4-yl]-1,3-thiazolidin-2-ylidene]cyanamide |
|---|---|
| PubChem CID | 15734829 |
| Molecular Formula | C15H16N4O4S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | [3-[(3R,4S)-3-hydroxy-2,2-dimethyl-6-nitro-3,4-dihydrochromen-4-yl]-1,3-thiazolidin-2-ylidene]cyanamide |
| SMILES | CC1(C)Oc2ccc([N+](=O)[O-])cc2[C@H](N2CCS/C2=N\C#N)[C@H]1O |
| InChI | InChI=1S/C15H16N4O4S/c1-15(2)13(20)12(18-5-6-24-14(18)17-8-16)10-7-9(19(21)22)3-4-11(10)23-15/h3-4,7,12-13,20H,5-6H2,1-2H3/b17-14-/t12-,13+/m0/s1 |
| InChIKey | OUFQDGWJDFTYJD-LSWRPLHASA-N |
| XLogP | 2.05 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|