About 3-[(2,4-dichlorophenoxy)methyl]-2-methoxybenzoic acid;1-(2-methoxy-3-methylphenyl)ethanone
3-[(2,4-dichlorophenoxy)methyl]-2-methoxybenzoic acid;1-(2-methoxy-3-methylphenyl)ethanone (PubChem CID 157348930) has the molecular formula C25H24Cl2O6
and a molecular weight of 491.37 g/mol. Its IUPAC name is 3-[(2,4-dichlorophenoxy)methyl]-2-methoxybenzoic acid;1-(2-methoxy-3-methylphenyl)ethanone.
Molecular Properties
| Compound Name | 3-[(2,4-dichlorophenoxy)methyl]-2-methoxybenzoic acid;1-(2-methoxy-3-methylphenyl)ethanone |
| PubChem CID | 157348930 |
| Molecular Formula | C25H24Cl2O6 |
| Molecular Weight | 491.37 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | 3-[(2,4-dichlorophenoxy)methyl]-2-methoxybenzoic acid;1-(2-methoxy-3-methylphenyl)ethanone |
| SMILES | COc1c(C)cccc1C(C)=O.COc1c(COc2ccc(Cl)cc2Cl)cccc1C(=O)O |
| InChI | InChI=1S/C15H12Cl2O4.C10H12O2/c1-20-14-9(3-2-4-11(14)15(18)19)8-21-13-6-5-10(16)7-12(13)17;1-7-5-4-6-9(8(2)11)10(7)12-3/h2-7H,8H2,1H3,(H,18,19);4-6H,1-3H3 |
| InChIKey | BHHLSYVBKHYJBV-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 491.37 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(2,4-dichlorophenoxy)methyl]-2-methoxybenzoic acid;1-(2-methoxy-3-methylphenyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,4-dichlorophenoxy)methyl]-2-methoxybenzoic acid;1-(2-methoxy-3-methylphenyl)ethanone?
The IUPAC name of 3-[(2,4-dichlorophenoxy)methyl]-2-methoxybenzoic acid;1-(2-methoxy-3-methylphenyl)ethanone (CID 157348930) is 3-[(2,4-dichlorophenoxy)methyl]-2-methoxybenzoic acid;1-(2-methoxy-3-methylphenyl)ethanone.
What is the SMILES notation for 3-[(2,4-dichlorophenoxy)methyl]-2-methoxybenzoic acid;1-(2-methoxy-3-methylphenyl)ethanone?
The canonical SMILES for 3-[(2,4-dichlorophenoxy)methyl]-2-methoxybenzoic acid;1-(2-methoxy-3-methylphenyl)ethanone is COc1c(C)cccc1C(C)=O.COc1c(COc2ccc(Cl)cc2Cl)cccc1C(=O)O.
What is the InChIKey of 3-[(2,4-dichlorophenoxy)methyl]-2-methoxybenzoic acid;1-(2-methoxy-3-methylphenyl)ethanone?
The InChIKey is BHHLSYVBKHYJBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12Cl2O4.C10H12O2/c1-20-14-9(3-2-4-11(14)15(18)19)8-21-13-6-5-10(16)7-12(13)17;1-7-5-4-6-9(8(2)11)10(7)12-3/h2-7H,8H2,1H3,(H,18,19);4-6H,1-3H3.
What are the key properties of 3-[(2,4-dichlorophenoxy)methyl]-2-methoxybenzoic acid;1-(2-methoxy-3-methylphenyl)ethanone?
3-[(2,4-dichlorophenoxy)methyl]-2-methoxybenzoic acid;1-(2-methoxy-3-methylphenyl)ethanone has a molecular weight of 491.37 g/mol, XLogP of 6.49, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,4-dichlorophenoxy)methyl]-2-methoxybenzoic acid;1-(2-methoxy-3-methylphenyl)ethanone is sourced from PubChem (CID 157348930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).