About 6,8-dihydropyrido[3,4-c]azepin-7-one
6,8-dihydropyrido[3,4-c]azepin-7-one (PubChem CID 157349684) has the molecular formula C9H8N2O
and a molecular weight of 160.18 g/mol. Its IUPAC name is 6,8-dihydropyrido[3,4-c]azepin-7-one.
Molecular Properties
| Compound Name | 6,8-dihydropyrido[3,4-c]azepin-7-one |
| PubChem CID | 157349684 |
| Molecular Formula | C9H8N2O |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | 6,8-dihydropyrido[3,4-c]azepin-7-one |
| SMILES | O=C1CC=c2ccncc2=CN1 |
| InChI | InChI=1S/C9H8N2O/c12-9-2-1-7-3-4-10-5-8(7)6-11-9/h1,3-6H,2H2,(H,11,12) |
| InChIKey | BHJOEQZXNHUSBT-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,8-dihydropyrido[3,4-c]azepin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dihydropyrido[3,4-c]azepin-7-one?
The IUPAC name of 6,8-dihydropyrido[3,4-c]azepin-7-one (CID 157349684) is 6,8-dihydropyrido[3,4-c]azepin-7-one.
What is the SMILES notation for 6,8-dihydropyrido[3,4-c]azepin-7-one?
The canonical SMILES for 6,8-dihydropyrido[3,4-c]azepin-7-one is O=C1CC=c2ccncc2=CN1.
What is the InChIKey of 6,8-dihydropyrido[3,4-c]azepin-7-one?
The InChIKey is BHJOEQZXNHUSBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O/c12-9-2-1-7-3-4-10-5-8(7)6-11-9/h1,3-6H,2H2,(H,11,12).
What are the key properties of 6,8-dihydropyrido[3,4-c]azepin-7-one?
6,8-dihydropyrido[3,4-c]azepin-7-one has a molecular weight of 160.18 g/mol, XLogP of -0.88, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dihydropyrido[3,4-c]azepin-7-one is sourced from PubChem (CID 157349684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).