About CID 157350938
CID 157350938 (PubChem CID 157350938) has the molecular formula C35H41BN10O5
and a molecular weight of 692.59 g/mol.
Molecular Properties
| Compound Name | CID 157350938 |
| PubChem CID | 157350938 |
| Molecular Formula | C35H41BN10O5 |
| Molecular Weight | 692.59 g/mol |
| Exact Mass | 692.34 |
| IUPAC Name | — |
| SMILES | CNC(=O)[C@H](C)NC(=O)c1nc(-c2ccccc2)n2c1CNCC2.[B]C(=O)N1CCn2c(-c3ccccc3)nc(C(=O)N[C@@H](C)C(=O)NC)c2C1 |
| InChI | InChI=1S/C18H20BN5O3.C17H21N5O2/c1-11(16(25)20-2)21-17(26)14-13-10-23(18(19)27)8-9-24(13)15(22-14)12-6-4-3-5-7-12;1-11(16(23)18-2)20-17(24)14-13-10-19-8-9-22(13)15(21-14)12-6-4-3-5-7-12/h3-7,11H,8-10H2,1-2H3,(H,20,25)(H,21,26);3-7,11,19H,8-10H2,1-2H3,(H,18,23)(H,20,24)/t2*11-/m00/s1 |
| InChIKey | NDWDQTGYDVUHSR-QHUNOZLZSA-N |
| XLogP | 1.04 |
| TPSA | 184.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 692.59 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 157350938 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 157350938?
The IUPAC name of CID 157350938 (CID 157350938) is not available.
What is the SMILES notation for CID 157350938?
The canonical SMILES for CID 157350938 is CNC(=O)[C@H](C)NC(=O)c1nc(-c2ccccc2)n2c1CNCC2.[B]C(=O)N1CCn2c(-c3ccccc3)nc(C(=O)N[C@@H](C)C(=O)NC)c2C1.
What is the InChIKey of CID 157350938?
The InChIKey is NDWDQTGYDVUHSR-QHUNOZLZSA-N. The full InChI is InChI=1S/C18H20BN5O3.C17H21N5O2/c1-11(16(25)20-2)21-17(26)14-13-10-23(18(19)27)8-9-24(13)15(22-14)12-6-4-3-5-7-12;1-11(16(23)18-2)20-17(24)14-13-10-19-8-9-22(13)15(21-14)12-6-4-3-5-7-12/h3-7,11H,8-10H2,1-2H3,(H,20,25)(H,21,26);3-7,11,19H,8-10H2,1-2H3,(H,18,23)(H,20,24)/t2*11-/m00/s1.
What are the key properties of CID 157350938?
CID 157350938 has a molecular weight of 692.59 g/mol, XLogP of 1.04, 8 rotatable bonds, 5 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 157350938 is sourced from PubChem (CID 157350938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).