C29H43NO2 — CID 157351184
(3S,8S,9S,10R,13S,14S,17S)-17-[(2R)-2-hydroxy-4-(6-methyl-2-pyridinyl)butan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 157351184) has the molecular formula C29H43NO2 and a molecular weight of 437.67 g/mol. Its IUPAC name is (3S,8S,9S,10R,13S,14S,17S)-17-[(2R)-2-hydroxy-4-(6-methyl-2-pyridinyl)butan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,10R,13S,14S,17S)-17-[(2R)-2-hydroxy-4-(6-methyl-2-pyridinyl)butan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 157351184 |
| Molecular Formula | C29H43NO2 |
| Molecular Weight | 437.67 g/mol |
| Exact Mass | 437.33 |
| IUPAC Name | (3S,8S,9S,10R,13S,14S,17S)-17-[(2R)-2-hydroxy-4-(6-methyl-2-pyridinyl)butan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | Cc1cccc(CC[C@@](C)(O)[C@H]2CC[C@H]3[C@@H]4CC=C5C[C@@H](O)CC[C@]5(C)[C@H]4CC[C@@]32C)n1 |
| InChI | InChI=1S/C29H43NO2/c1-19-6-5-7-21(30-19)12-17-29(4,32)26-11-10-24-23-9-8-20-18-22(31)13-15-27(20,2)25(23)14-16-28(24,26)3/h5-8,22-26,31-32H,9-18H2,1-4H3/t22-,23-,24-,25-,26-,27-,28-,29+/m0/s1 |
| InChIKey | PSIOHLDAILDOHG-NBCYFHGJSA-N |
| XLogP | 6.01 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.67 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|