C32H60O3Si — CID 157351545
tert-butyl-[(1R,2S,3R,4S,5R,6R)-4-(methoxymethoxy)-2,3,6-trimethyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohexyl]oxy-dimethylsilane (PubChem CID 157351545) has the molecular formula C32H60O3Si and a molecular weight of 520.92 g/mol. Its IUPAC name is tert-butyl-[(1R,2S,3R,4S,5R,6R)-4-(methoxymethoxy)-2,3,6-trimethyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohexyl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1R,2S,3R,4S,5R,6R)-4-(methoxymethoxy)-2,3,6-trimethyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohexyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 157351545 |
| Molecular Formula | C32H60O3Si |
| Molecular Weight | 520.92 g/mol |
| Exact Mass | 520.43 |
| IUPAC Name | tert-butyl-[(1R,2S,3R,4S,5R,6R)-4-(methoxymethoxy)-2,3,6-trimethyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohexyl]oxy-dimethylsilane |
| SMILES | COCO[C@H]1[C@H](C)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H]1C/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C32H60O3Si/c1-23(2)16-14-17-24(3)18-15-19-25(4)20-21-29-28(7)30(35-36(12,13)32(8,9)10)26(5)27(6)31(29)34-22-33-11/h16,18,20,26-31H,14-15,17,19,21-22H2,1-13H3/b24-18+,25-20+/t26-,27+,28+,29+,30+,31-/m0/s1 |
| InChIKey | BBPBNVYDDYQCHA-BPNBWBHPSA-N |
| XLogP | 9.71 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.92 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|