C25H40ClN5O4 — CID 157351944
[(4R,9R,14R,19R)-25-chloro-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(25),22(26),23-trien-23-yl] 2-methoxyethyl carbonate (PubChem CID 157351944) has the molecular formula C25H40ClN5O4 and a molecular weight of 510.08 g/mol. Its IUPAC name is [(4R,9R,14R,19R)-25-chloro-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(25),22(26),23-trien-23-yl] 2-methoxyethyl carbonate.
| Compound Name | [(4R,9R,14R,19R)-25-chloro-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(25),22(26),23-trien-23-yl] 2-methoxyethyl carbonate |
|---|---|
| PubChem CID | 157351944 |
| Molecular Formula | C25H40ClN5O4 |
| Molecular Weight | 510.08 g/mol |
| Exact Mass | 509.28 |
| IUPAC Name | [(4R,9R,14R,19R)-25-chloro-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(25),22(26),23-trien-23-yl] 2-methoxyethyl carbonate |
| SMILES | COCCOC(=O)Oc1cc(Cl)c2nc1CN[C@@H]1CCCC[C@H]1NCCN[C@@H]1CCCC[C@H]1NC2 |
| InChI | InChI=1S/C25H40ClN5O4/c1-33-12-13-34-25(32)35-24-14-17(26)22-15-29-20-8-4-2-6-18(20)27-10-11-28-19-7-3-5-9-21(19)30-16-23(24)31-22/h14,18-21,27-30H,2-13,15-16H2,1H3/t18-,19-,20-,21-/m1/s1 |
| InChIKey | ZTWWSSMGTSBNNB-XRXFAXGQSA-N |
| XLogP | 2.89 |
| TPSA | 105.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.08 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|