About 5-(difluoromethyl)-3-(3-methoxy-4-nitrophenoxy)-1,4-dimethylpyrazole
5-(difluoromethyl)-3-(3-methoxy-4-nitrophenoxy)-1,4-dimethylpyrazole (PubChem CID 15735343) has the molecular formula C13H13F2N3O4
and a molecular weight of 313.26 g/mol. Its IUPAC name is 5-(difluoromethyl)-3-(3-methoxy-4-nitrophenoxy)-1,4-dimethylpyrazole.
Molecular Properties
| Compound Name | 5-(difluoromethyl)-3-(3-methoxy-4-nitrophenoxy)-1,4-dimethylpyrazole |
| PubChem CID | 15735343 |
| Molecular Formula | C13H13F2N3O4 |
| Molecular Weight | 313.26 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 5-(difluoromethyl)-3-(3-methoxy-4-nitrophenoxy)-1,4-dimethylpyrazole |
| SMILES | COc1cc(Oc2nn(C)c(C(F)F)c2C)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H13F2N3O4/c1-7-11(12(14)15)17(2)16-13(7)22-8-4-5-9(18(19)20)10(6-8)21-3/h4-6,12H,1-3H3 |
| InChIKey | PLYRPLLNHXZPTH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 79.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.26 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(difluoromethyl)-3-(3-methoxy-4-nitrophenoxy)-1,4-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(difluoromethyl)-3-(3-methoxy-4-nitrophenoxy)-1,4-dimethylpyrazole?
The IUPAC name of 5-(difluoromethyl)-3-(3-methoxy-4-nitrophenoxy)-1,4-dimethylpyrazole (CID 15735343) is 5-(difluoromethyl)-3-(3-methoxy-4-nitrophenoxy)-1,4-dimethylpyrazole.
What is the SMILES notation for 5-(difluoromethyl)-3-(3-methoxy-4-nitrophenoxy)-1,4-dimethylpyrazole?
The canonical SMILES for 5-(difluoromethyl)-3-(3-methoxy-4-nitrophenoxy)-1,4-dimethylpyrazole is COc1cc(Oc2nn(C)c(C(F)F)c2C)ccc1[N+](=O)[O-].
What is the InChIKey of 5-(difluoromethyl)-3-(3-methoxy-4-nitrophenoxy)-1,4-dimethylpyrazole?
The InChIKey is PLYRPLLNHXZPTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F2N3O4/c1-7-11(12(14)15)17(2)16-13(7)22-8-4-5-9(18(19)20)10(6-8)21-3/h4-6,12H,1-3H3.
What are the key properties of 5-(difluoromethyl)-3-(3-methoxy-4-nitrophenoxy)-1,4-dimethylpyrazole?
5-(difluoromethyl)-3-(3-methoxy-4-nitrophenoxy)-1,4-dimethylpyrazole has a molecular weight of 313.26 g/mol, XLogP of 3.38, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(difluoromethyl)-3-(3-methoxy-4-nitrophenoxy)-1,4-dimethylpyrazole is sourced from PubChem (CID 15735343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).