About cyclohexa-2,5-diene-1,4-dione;1,3-dioxole
cyclohexa-2,5-diene-1,4-dione;1,3-dioxole (PubChem CID 157355152) has the molecular formula C9H8O4
and a molecular weight of 180.16 g/mol. Its IUPAC name is cyclohexa-2,5-diene-1,4-dione;1,3-dioxole.
Molecular Properties
| Compound Name | cyclohexa-2,5-diene-1,4-dione;1,3-dioxole |
| PubChem CID | 157355152 |
| Molecular Formula | C9H8O4 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | cyclohexa-2,5-diene-1,4-dione;1,3-dioxole |
| SMILES | C1=COCO1.O=C1C=CC(=O)C=C1 |
| InChI | InChI=1S/C6H4O2.C3H4O2/c7-5-1-2-6(8)4-3-5;1-2-5-3-4-1/h1-4H;1-2H,3H2 |
| InChIKey | BHZMHRBDKUYLTH-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze cyclohexa-2,5-diene-1,4-dione;1,3-dioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-2,5-diene-1,4-dione;1,3-dioxole?
The IUPAC name of cyclohexa-2,5-diene-1,4-dione;1,3-dioxole (CID 157355152) is cyclohexa-2,5-diene-1,4-dione;1,3-dioxole.
What is the SMILES notation for cyclohexa-2,5-diene-1,4-dione;1,3-dioxole?
The canonical SMILES for cyclohexa-2,5-diene-1,4-dione;1,3-dioxole is C1=COCO1.O=C1C=CC(=O)C=C1.
What is the InChIKey of cyclohexa-2,5-diene-1,4-dione;1,3-dioxole?
The InChIKey is BHZMHRBDKUYLTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4O2.C3H4O2/c7-5-1-2-6(8)4-3-5;1-2-5-3-4-1/h1-4H;1-2H,3H2.
What are the key properties of cyclohexa-2,5-diene-1,4-dione;1,3-dioxole?
cyclohexa-2,5-diene-1,4-dione;1,3-dioxole has a molecular weight of 180.16 g/mol, XLogP of 0.71, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-2,5-diene-1,4-dione;1,3-dioxole is sourced from PubChem (CID 157355152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).