About [3,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl] 2,2-dimethylbutanoate
[3,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl] 2,2-dimethylbutanoate (PubChem CID 157355191) has the molecular formula C13H21F3O3
and a molecular weight of 282.30 g/mol. Its IUPAC name is [3,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl] 2,2-dimethylbutanoate.
Molecular Properties
| Compound Name | [3,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl] 2,2-dimethylbutanoate |
| PubChem CID | 157355191 |
| Molecular Formula | C13H21F3O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | [3,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1OC(C)(C(F)(F)F)CC1C |
| InChI | InChI=1S/C13H21F3O3/c1-6-11(3,4)10(17)18-9-8(2)7-12(5,19-9)13(14,15)16/h8-9H,6-7H2,1-5H3 |
| InChIKey | QCXOSTFMUAIJTP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl] 2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl] 2,2-dimethylbutanoate?
The IUPAC name of [3,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl] 2,2-dimethylbutanoate (CID 157355191) is [3,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl] 2,2-dimethylbutanoate.
What is the SMILES notation for [3,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl] 2,2-dimethylbutanoate?
The canonical SMILES for [3,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl] 2,2-dimethylbutanoate is CCC(C)(C)C(=O)OC1OC(C)(C(F)(F)F)CC1C.
What is the InChIKey of [3,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl] 2,2-dimethylbutanoate?
The InChIKey is QCXOSTFMUAIJTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21F3O3/c1-6-11(3,4)10(17)18-9-8(2)7-12(5,19-9)13(14,15)16/h8-9H,6-7H2,1-5H3.
What are the key properties of [3,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl] 2,2-dimethylbutanoate?
[3,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl] 2,2-dimethylbutanoate has a molecular weight of 282.30 g/mol, XLogP of 3.67, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-dimethyl-5-(trifluoromethyl)oxolan-2-yl] 2,2-dimethylbutanoate is sourced from PubChem (CID 157355191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).