C26H29F4NO3S — CID 157355823
(4S)-2-fluoro-2-methyl-4-[[(1S)-2,2,2-trifluoro-1-[4-(4-methylsulfonylphenyl)phenyl]ethyl]amino]dec-8-yn-5-one (PubChem CID 157355823) has the molecular formula C26H29F4NO3S and a molecular weight of 511.58 g/mol. Its IUPAC name is (4S)-2-fluoro-2-methyl-4-[[(1S)-2,2,2-trifluoro-1-[4-(4-methylsulfonylphenyl)phenyl]ethyl]amino]dec-8-yn-5-one.
| Compound Name | (4S)-2-fluoro-2-methyl-4-[[(1S)-2,2,2-trifluoro-1-[4-(4-methylsulfonylphenyl)phenyl]ethyl]amino]dec-8-yn-5-one |
|---|---|
| PubChem CID | 157355823 |
| Molecular Formula | C26H29F4NO3S |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | (4S)-2-fluoro-2-methyl-4-[[(1S)-2,2,2-trifluoro-1-[4-(4-methylsulfonylphenyl)phenyl]ethyl]amino]dec-8-yn-5-one |
| SMILES | CC#CCCC(=O)[C@H](CC(C)(C)F)N[C@@H](c1ccc(-c2ccc(S(C)(=O)=O)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C26H29F4NO3S/c1-5-6-7-8-23(32)22(17-25(2,3)27)31-24(26(28,29)30)20-11-9-18(10-12-20)19-13-15-21(16-14-19)35(4,33)34/h9-16,22,24,31H,7-8,17H2,1-4H3/t22-,24-/m0/s1 |
| InChIKey | MMAJDSXVLBDVFT-UPVQGACJSA-N |
| XLogP | 5.83 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|