About CID 157355859
CID 157355859 (PubChem CID 157355859) has the molecular formula C43H39B9F2O11S
and a molecular weight of 899.14 g/mol.
Molecular Properties
| Compound Name | CID 157355859 |
| PubChem CID | 157355859 |
| Molecular Formula | C43H39B9F2O11S |
| Molecular Weight | 899.14 g/mol |
| Exact Mass | 900.30 |
| IUPAC Name | — |
| SMILES | [B]Cc1cc(C[B])c(C[B])c(C(=O)OC23CC4(OC(=O)c5cc(C[B])cc(C[B])c5C[B])CC(OC(=O)c5c(C[B])ccc(C[B])c5C[B])(C2)CC(C(=O)OCC(F)(F)S(=O)(=O)O)(C3)C4)c1 |
| InChI | InChI=1S/C43H39B9F2O11S/c44-7-23-3-27(11-48)31(13-50)29(5-23)35(55)63-40-16-39(38(58)62-22-43(53,54)66(59,60)61)17-41(19-40,64-36(56)30-6-24(8-45)4-28(12-49)32(30)14-51)21-42(18-39,20-40)65-37(57)34-26(10-47)2-1-25(9-46)33(34)15-52/h1-6H,7-22H2,(H,59,60,61) |
| InChIKey | HFKSQUDYFUASPA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 159.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 66 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 899.14 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze CID 157355859 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 157355859?
The IUPAC name of CID 157355859 (CID 157355859) is not available.
What is the SMILES notation for CID 157355859?
The canonical SMILES for CID 157355859 is [B]Cc1cc(C[B])c(C[B])c(C(=O)OC23CC4(OC(=O)c5cc(C[B])cc(C[B])c5C[B])CC(OC(=O)c5c(C[B])ccc(C[B])c5C[B])(C2)CC(C(=O)OCC(F)(F)S(=O)(=O)O)(C3)C4)c1.
What is the InChIKey of CID 157355859?
The InChIKey is HFKSQUDYFUASPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C43H39B9F2O11S/c44-7-23-3-27(11-48)31(13-50)29(5-23)35(55)63-40-16-39(38(58)62-22-43(53,54)66(59,60)61)17-41(19-40,64-36(56)30-6-24(8-45)4-28(12-49)32(30)14-51)21-42(18-39,20-40)65-37(57)34-26(10-47)2-1-25(9-46)33(34)15-52/h1-6H,7-22H2,(H,59,60,61).
What are the key properties of CID 157355859?
CID 157355859 has a molecular weight of 899.14 g/mol, XLogP of 2.18, 19 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 157355859 is sourced from PubChem (CID 157355859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).