C29H37FN2O4 — CID 157357789
2-[5-fluoro-2-(oxolan-2-yl)phenyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid (PubChem CID 157357789) has the molecular formula C29H37FN2O4 and a molecular weight of 496.62 g/mol. Its IUPAC name is 2-[5-fluoro-2-(oxolan-2-yl)phenyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid.
| Compound Name | 2-[5-fluoro-2-(oxolan-2-yl)phenyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 157357789 |
| Molecular Formula | C29H37FN2O4 |
| Molecular Weight | 496.62 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | 2-[5-fluoro-2-(oxolan-2-yl)phenyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
| SMILES | O=C(O)C(c1cc(F)ccc1C1CCCO1)N1CC[C@@H](OCCCCc2ccc3c(n2)CCCC3)C1 |
| InChI | InChI=1S/C29H37FN2O4/c30-21-11-13-24(27-9-5-17-36-27)25(18-21)28(29(33)34)32-15-14-23(19-32)35-16-4-3-7-22-12-10-20-6-1-2-8-26(20)31-22/h10-13,18,23,27-28H,1-9,14-17,19H2,(H,33,34)/t23-,27?,28?/m1/s1 |
| InChIKey | BIHGGLWFORGRQC-YHHYGRTJSA-N |
| XLogP | 5.19 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.62 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|