C24H38IN3O2 — CID 157358178
tert-butyl 2-[4-[[(2R)-2-ethyl-4-(4-iodophenyl)piperazin-1-yl]methyl]piperidin-1-yl]acetate (PubChem CID 157358178) has the molecular formula C24H38IN3O2 and a molecular weight of 527.49 g/mol. Its IUPAC name is tert-butyl 2-[4-[[(2R)-2-ethyl-4-(4-iodophenyl)piperazin-1-yl]methyl]piperidin-1-yl]acetate.
| Compound Name | tert-butyl 2-[4-[[(2R)-2-ethyl-4-(4-iodophenyl)piperazin-1-yl]methyl]piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 157358178 |
| Molecular Formula | C24H38IN3O2 |
| Molecular Weight | 527.49 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | tert-butyl 2-[4-[[(2R)-2-ethyl-4-(4-iodophenyl)piperazin-1-yl]methyl]piperidin-1-yl]acetate |
| SMILES | CC[C@@H]1CN(c2ccc(I)cc2)CCN1CC1CCN(CC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C24H38IN3O2/c1-5-21-17-28(22-8-6-20(25)7-9-22)15-14-27(21)16-19-10-12-26(13-11-19)18-23(29)30-24(2,3)4/h6-9,19,21H,5,10-18H2,1-4H3/t21-/m1/s1 |
| InChIKey | BIIHGYJXLLMXNZ-OAQYLSRUSA-N |
| XLogP | 4.25 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.49 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|