C11H7F4O5S- — CID 157358210
2,3,5,6-tetrafluoro-4-pent-4-enoyloxybenzenesulfonate (PubChem CID 157358210) has the molecular formula C11H7F4O5S- and a molecular weight of 327.23 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-pent-4-enoyloxybenzenesulfonate.
| Compound Name | 2,3,5,6-tetrafluoro-4-pent-4-enoyloxybenzenesulfonate |
|---|---|
| PubChem CID | 157358210 |
| Molecular Formula | C11H7F4O5S- |
| Molecular Weight | 327.23 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-pent-4-enoyloxybenzenesulfonate |
| SMILES | C=CCCC(=O)Oc1c(F)c(F)c(S(=O)(=O)[O-])c(F)c1F |
| InChI | InChI=1S/C11H8F4O5S/c1-2-3-4-5(16)20-10-6(12)8(14)11(21(17,18)19)9(15)7(10)13/h2H,1,3-4H2,(H,17,18,19)/p-1 |
| InChIKey | BIIJSSKKNDLRPE-UHFFFAOYSA-M |
| XLogP | 2.02 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.23 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|