About sodium;3-methylbenzenesulfonate;2-methyl-5-methylsulfonyl-1,3,4-thiadiazole
sodium;3-methylbenzenesulfonate;2-methyl-5-methylsulfonyl-1,3,4-thiadiazole (PubChem CID 157359081) has the molecular formula C11H13N2NaO5S3
and a molecular weight of 372.43 g/mol. Its IUPAC name is sodium;3-methylbenzenesulfonate;2-methyl-5-methylsulfonyl-1,3,4-thiadiazole.
Molecular Properties
| Compound Name | sodium;3-methylbenzenesulfonate;2-methyl-5-methylsulfonyl-1,3,4-thiadiazole |
| PubChem CID | 157359081 |
| Molecular Formula | C11H13N2NaO5S3 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 371.99 |
| IUPAC Name | sodium;3-methylbenzenesulfonate;2-methyl-5-methylsulfonyl-1,3,4-thiadiazole |
| SMILES | Cc1cccc(S(=O)(=O)[O-])c1.Cc1nnc(S(C)(=O)=O)s1.[Na+] |
| InChI | InChI=1S/C7H8O3S.C4H6N2O2S2.Na/c1-6-3-2-4-7(5-6)11(8,9)10;1-3-5-6-4(9-3)10(2,7)8;/h2-5H,1H3,(H,8,9,10);1-2H3;/q;;+1/p-1 |
| InChIKey | BIKSACXDNQYEMQ-UHFFFAOYSA-M |
| XLogP | -1.85 |
| TPSA | 117.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;3-methylbenzenesulfonate;2-methyl-5-methylsulfonyl-1,3,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;3-methylbenzenesulfonate;2-methyl-5-methylsulfonyl-1,3,4-thiadiazole?
The IUPAC name of sodium;3-methylbenzenesulfonate;2-methyl-5-methylsulfonyl-1,3,4-thiadiazole (CID 157359081) is sodium;3-methylbenzenesulfonate;2-methyl-5-methylsulfonyl-1,3,4-thiadiazole.
What is the SMILES notation for sodium;3-methylbenzenesulfonate;2-methyl-5-methylsulfonyl-1,3,4-thiadiazole?
The canonical SMILES for sodium;3-methylbenzenesulfonate;2-methyl-5-methylsulfonyl-1,3,4-thiadiazole is Cc1cccc(S(=O)(=O)[O-])c1.Cc1nnc(S(C)(=O)=O)s1.[Na+].
What is the InChIKey of sodium;3-methylbenzenesulfonate;2-methyl-5-methylsulfonyl-1,3,4-thiadiazole?
The InChIKey is BIKSACXDNQYEMQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8O3S.C4H6N2O2S2.Na/c1-6-3-2-4-7(5-6)11(8,9)10;1-3-5-6-4(9-3)10(2,7)8;/h2-5H,1H3,(H,8,9,10);1-2H3;/q;;+1/p-1.
What are the key properties of sodium;3-methylbenzenesulfonate;2-methyl-5-methylsulfonyl-1,3,4-thiadiazole?
sodium;3-methylbenzenesulfonate;2-methyl-5-methylsulfonyl-1,3,4-thiadiazole has a molecular weight of 372.43 g/mol, XLogP of -1.85, 2 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;3-methylbenzenesulfonate;2-methyl-5-methylsulfonyl-1,3,4-thiadiazole is sourced from PubChem (CID 157359081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).