C37H49Br4Cl2N5O3 — CID 157359478
N-butyl-4,6-dichloro-N-(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazin-2-amine;2,6-dibromo-4-[2-(3,5-dibromo-4-hydroxyphenyl)propan-2-yl]phenol (PubChem CID 157359478) has the molecular formula C37H49Br4Cl2N5O3 and a molecular weight of 1002.35 g/mol. Its IUPAC name is N-butyl-4,6-dichloro-N-(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazin-2-amine;2,6-dibromo-4-[2-(3,5-dibromo-4-hydroxyphenyl)propan-2-yl]phenol.
| Compound Name | N-butyl-4,6-dichloro-N-(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazin-2-amine;2,6-dibromo-4-[2-(3,5-dibromo-4-hydroxyphenyl)propan-2-yl]phenol |
|---|---|
| PubChem CID | 157359478 |
| Molecular Formula | C37H49Br4Cl2N5O3 |
| Molecular Weight | 1002.35 g/mol |
| Exact Mass | 996.99 |
| IUPAC Name | N-butyl-4,6-dichloro-N-(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazin-2-amine;2,6-dibromo-4-[2-(3,5-dibromo-4-hydroxyphenyl)propan-2-yl]phenol |
| SMILES | CC(C)(c1cc(Br)c(O)c(Br)c1)c1cc(Br)c(O)c(Br)c1.CCCCN(c1nc(Cl)nc(Cl)n1)C1CC(C)(C)N(OC2CCCCC2)C(C)(C)C1 |
| InChI | InChI=1S/C22H37Cl2N5O.C15H12Br4O2/c1-6-7-13-28(20-26-18(23)25-19(24)27-20)16-14-21(2,3)29(22(4,5)15-16)30-17-11-9-8-10-12-17;1-15(2,7-3-9(16)13(20)10(17)4-7)8-5-11(18)14(21)12(19)6-8/h16-17H,6-15H2,1-5H3;3-6,20-21H,1-2H3 |
| InChIKey | BILSHANTXPPESS-UHFFFAOYSA-N |
| XLogP | 12.54 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1002.35 |
| LogP ≤ 5 | 12.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |