C29H46N2O — CID 157360031
N-cyclohexyl-4-propan-2-ylaniline;methane;N-(4-propan-2-ylphenyl)oxolan-3-amine (PubChem CID 157360031) has the molecular formula C29H46N2O and a molecular weight of 438.70 g/mol. Its IUPAC name is N-cyclohexyl-4-propan-2-ylaniline;methane;N-(4-propan-2-ylphenyl)oxolan-3-amine.
| Compound Name | N-cyclohexyl-4-propan-2-ylaniline;methane;N-(4-propan-2-ylphenyl)oxolan-3-amine |
|---|---|
| PubChem CID | 157360031 |
| Molecular Formula | C29H46N2O |
| Molecular Weight | 438.70 g/mol |
| Exact Mass | 438.36 |
| IUPAC Name | N-cyclohexyl-4-propan-2-ylaniline;methane;N-(4-propan-2-ylphenyl)oxolan-3-amine |
| SMILES | C.CC(C)c1ccc(NC2CCCCC2)cc1.CC(C)c1ccc(NC2CCOC2)cc1 |
| InChI | InChI=1S/C15H23N.C13H19NO.CH4/c1-12(2)13-8-10-15(11-9-13)16-14-6-4-3-5-7-14;1-10(2)11-3-5-12(6-4-11)14-13-7-8-15-9-13;/h8-12,14,16H,3-7H2,1-2H3;3-6,10,13-14H,7-9H2,1-2H3;1H4 |
| InChIKey | BINKSOHQRXYIDL-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.70 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |