About 2-methylbut-2-ene;propane-1,2,3-triol
2-methylbut-2-ene;propane-1,2,3-triol (PubChem CID 157360494) has the molecular formula C8H18O3
and a molecular weight of 162.23 g/mol. Its IUPAC name is 2-methylbut-2-ene;propane-1,2,3-triol.
Molecular Properties
| Compound Name | 2-methylbut-2-ene;propane-1,2,3-triol |
| PubChem CID | 157360494 |
| Molecular Formula | C8H18O3 |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.13 |
| IUPAC Name | 2-methylbut-2-ene;propane-1,2,3-triol |
| SMILES | CC=C(C)C.OCC(O)CO |
| InChI | InChI=1S/C5H10.C3H8O3/c1-4-5(2)3;4-1-3(6)2-5/h4H,1-3H3;3-6H,1-2H2 |
| InChIKey | BIOSYHVWNHWCTH-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbut-2-ene;propane-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbut-2-ene;propane-1,2,3-triol?
The IUPAC name of 2-methylbut-2-ene;propane-1,2,3-triol (CID 157360494) is 2-methylbut-2-ene;propane-1,2,3-triol.
What is the SMILES notation for 2-methylbut-2-ene;propane-1,2,3-triol?
The canonical SMILES for 2-methylbut-2-ene;propane-1,2,3-triol is CC=C(C)C.OCC(O)CO.
What is the InChIKey of 2-methylbut-2-ene;propane-1,2,3-triol?
The InChIKey is BIOSYHVWNHWCTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10.C3H8O3/c1-4-5(2)3;4-1-3(6)2-5/h4H,1-3H3;3-6H,1-2H2.
What are the key properties of 2-methylbut-2-ene;propane-1,2,3-triol?
2-methylbut-2-ene;propane-1,2,3-triol has a molecular weight of 162.23 g/mol, XLogP of 0.30, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbut-2-ene;propane-1,2,3-triol is sourced from PubChem (CID 157360494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).