C7H10F2N2O2 — CID 15736098
(3S,6R)-3-(1,1-difluoroethyl)-6-methylpiperazine-2,5-dione (PubChem CID 15736098) has the molecular formula C7H10F2N2O2 and a molecular weight of 192.16 g/mol. Its IUPAC name is (3S,6R)-3-(1,1-difluoroethyl)-6-methylpiperazine-2,5-dione.
| Compound Name | (3S,6R)-3-(1,1-difluoroethyl)-6-methylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 15736098 |
| Molecular Formula | C7H10F2N2O2 |
| Molecular Weight | 192.16 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | (3S,6R)-3-(1,1-difluoroethyl)-6-methylpiperazine-2,5-dione |
| SMILES | C[C@H]1NC(=O)[C@@H](C(C)(F)F)NC1=O |
| InChI | InChI=1S/C7H10F2N2O2/c1-3-5(12)11-4(6(13)10-3)7(2,8)9/h3-4H,1-2H3,(H,10,13)(H,11,12)/t3-,4+/m1/s1 |
| InChIKey | ZBLIJZCRBUEUEO-DMTCNVIQSA-N |
| XLogP | -0.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.16 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |