About 5-[di(thiophen-3-yl)methylidene]-2H-furan-2-ol;2-methylfuran
5-[di(thiophen-3-yl)methylidene]-2H-furan-2-ol;2-methylfuran (PubChem CID 157361878) has the molecular formula C18H16O3S2
and a molecular weight of 344.46 g/mol. Its IUPAC name is 5-[di(thiophen-3-yl)methylidene]-2H-furan-2-ol;2-methylfuran.
Molecular Properties
| Compound Name | 5-[di(thiophen-3-yl)methylidene]-2H-furan-2-ol;2-methylfuran |
| PubChem CID | 157361878 |
| Molecular Formula | C18H16O3S2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | 5-[di(thiophen-3-yl)methylidene]-2H-furan-2-ol;2-methylfuran |
| SMILES | Cc1ccco1.OC1C=CC(=C(c2ccsc2)c2ccsc2)O1 |
| InChI | InChI=1S/C13H10O2S2.C5H6O/c14-12-2-1-11(15-12)13(9-3-5-16-7-9)10-4-6-17-8-10;1-5-3-2-4-6-5/h1-8,12,14H;2-4H,1H3 |
| InChIKey | BISUBORZHMBNIB-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[di(thiophen-3-yl)methylidene]-2H-furan-2-ol;2-methylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[di(thiophen-3-yl)methylidene]-2H-furan-2-ol;2-methylfuran?
The IUPAC name of 5-[di(thiophen-3-yl)methylidene]-2H-furan-2-ol;2-methylfuran (CID 157361878) is 5-[di(thiophen-3-yl)methylidene]-2H-furan-2-ol;2-methylfuran.
What is the SMILES notation for 5-[di(thiophen-3-yl)methylidene]-2H-furan-2-ol;2-methylfuran?
The canonical SMILES for 5-[di(thiophen-3-yl)methylidene]-2H-furan-2-ol;2-methylfuran is Cc1ccco1.OC1C=CC(=C(c2ccsc2)c2ccsc2)O1.
What is the InChIKey of 5-[di(thiophen-3-yl)methylidene]-2H-furan-2-ol;2-methylfuran?
The InChIKey is BISUBORZHMBNIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O2S2.C5H6O/c14-12-2-1-11(15-12)13(9-3-5-16-7-9)10-4-6-17-8-10;1-5-3-2-4-6-5/h1-8,12,14H;2-4H,1H3.
What are the key properties of 5-[di(thiophen-3-yl)methylidene]-2H-furan-2-ol;2-methylfuran?
5-[di(thiophen-3-yl)methylidene]-2H-furan-2-ol;2-methylfuran has a molecular weight of 344.46 g/mol, XLogP of 5.06, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[di(thiophen-3-yl)methylidene]-2H-furan-2-ol;2-methylfuran is sourced from PubChem (CID 157361878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).