C33H47N7O3Si — CID 157362018
tert-butyl 4-[1-[2-[[6-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-1H-benzimidazol-2-yl]methyl]-4-pyridinyl]ethyl]piperazine-1-carboxylate (PubChem CID 157362018) has the molecular formula C33H47N7O3Si and a molecular weight of 617.87 g/mol. Its IUPAC name is tert-butyl 4-[1-[2-[[6-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-1H-benzimidazol-2-yl]methyl]-4-pyridinyl]ethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-[2-[[6-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-1H-benzimidazol-2-yl]methyl]-4-pyridinyl]ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 157362018 |
| Molecular Formula | C33H47N7O3Si |
| Molecular Weight | 617.87 g/mol |
| Exact Mass | 617.35 |
| IUPAC Name | tert-butyl 4-[1-[2-[[6-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]-1H-benzimidazol-2-yl]methyl]-4-pyridinyl]ethyl]piperazine-1-carboxylate |
| SMILES | CC(c1ccnc(Cc2nc3ccc(-c4cnn(COCC[Si](C)(C)C)c4)cc3[nH]2)c1)N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C33H47N7O3Si/c1-24(38-12-14-39(15-13-38)32(41)43-33(2,3)4)25-10-11-34-28(18-25)20-31-36-29-9-8-26(19-30(29)37-31)27-21-35-40(22-27)23-42-16-17-44(5,6)7/h8-11,18-19,21-22,24H,12-17,20,23H2,1-7H3,(H,36,37) |
| InChIKey | BITCJGVSPAWKGO-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 101.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.87 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|