About [5-acetyloxy-2-(4-acetyloxyphenyl)-3,6,7-trimethoxy-4-oxochromen-8-yl] 2-methylbutanoate
[5-acetyloxy-2-(4-acetyloxyphenyl)-3,6,7-trimethoxy-4-oxochromen-8-yl] 2-methylbutanoate (PubChem CID 15736243) has the molecular formula C27H28O11
and a molecular weight of 528.51 g/mol. Its IUPAC name is [5-acetyloxy-2-(4-acetyloxyphenyl)-3,6,7-trimethoxy-4-oxochromen-8-yl] 2-methylbutanoate.
Molecular Properties
| Compound Name | [5-acetyloxy-2-(4-acetyloxyphenyl)-3,6,7-trimethoxy-4-oxochromen-8-yl] 2-methylbutanoate |
| PubChem CID | 15736243 |
| Molecular Formula | C27H28O11 |
| Molecular Weight | 528.51 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | [5-acetyloxy-2-(4-acetyloxyphenyl)-3,6,7-trimethoxy-4-oxochromen-8-yl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)Oc1c(OC)c(OC)c(OC(C)=O)c2c(=O)c(OC)c(-c3ccc(OC(C)=O)cc3)oc12 |
| InChI | InChI=1S/C27H28O11/c1-8-13(2)27(31)38-26-22-18(21(36-15(4)29)24(33-6)25(26)34-7)19(30)23(32-5)20(37-22)16-9-11-17(12-10-16)35-14(3)28/h9-13H,8H2,1-7H3 |
| InChIKey | CZUMPBGRGPUWMT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 136.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 528.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [5-acetyloxy-2-(4-acetyloxyphenyl)-3,6,7-trimethoxy-4-oxochromen-8-yl] 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-acetyloxy-2-(4-acetyloxyphenyl)-3,6,7-trimethoxy-4-oxochromen-8-yl] 2-methylbutanoate?
The IUPAC name of [5-acetyloxy-2-(4-acetyloxyphenyl)-3,6,7-trimethoxy-4-oxochromen-8-yl] 2-methylbutanoate (CID 15736243) is [5-acetyloxy-2-(4-acetyloxyphenyl)-3,6,7-trimethoxy-4-oxochromen-8-yl] 2-methylbutanoate.
What is the SMILES notation for [5-acetyloxy-2-(4-acetyloxyphenyl)-3,6,7-trimethoxy-4-oxochromen-8-yl] 2-methylbutanoate?
The canonical SMILES for [5-acetyloxy-2-(4-acetyloxyphenyl)-3,6,7-trimethoxy-4-oxochromen-8-yl] 2-methylbutanoate is CCC(C)C(=O)Oc1c(OC)c(OC)c(OC(C)=O)c2c(=O)c(OC)c(-c3ccc(OC(C)=O)cc3)oc12.
What is the InChIKey of [5-acetyloxy-2-(4-acetyloxyphenyl)-3,6,7-trimethoxy-4-oxochromen-8-yl] 2-methylbutanoate?
The InChIKey is CZUMPBGRGPUWMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H28O11/c1-8-13(2)27(31)38-26-22-18(21(36-15(4)29)24(33-6)25(26)34-7)19(30)23(32-5)20(37-22)16-9-11-17(12-10-16)35-14(3)28/h9-13H,8H2,1-7H3.
What are the key properties of [5-acetyloxy-2-(4-acetyloxyphenyl)-3,6,7-trimethoxy-4-oxochromen-8-yl] 2-methylbutanoate?
[5-acetyloxy-2-(4-acetyloxyphenyl)-3,6,7-trimethoxy-4-oxochromen-8-yl] 2-methylbutanoate has a molecular weight of 528.51 g/mol, XLogP of 4.29, 9 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for [5-acetyloxy-2-(4-acetyloxyphenyl)-3,6,7-trimethoxy-4-oxochromen-8-yl] 2-methylbutanoate is sourced from PubChem (CID 15736243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).