C20H22ClN3O3 — CID 157362988
tert-butyl (2R)-2-[5-(5-chloro-2-methylpyrimidin-4-yl)-3-oxo-1H-isoindol-2-yl]propanoate (PubChem CID 157362988) has the molecular formula C20H22ClN3O3 and a molecular weight of 387.87 g/mol. Its IUPAC name is tert-butyl (2R)-2-[5-(5-chloro-2-methylpyrimidin-4-yl)-3-oxo-1H-isoindol-2-yl]propanoate.
| Compound Name | tert-butyl (2R)-2-[5-(5-chloro-2-methylpyrimidin-4-yl)-3-oxo-1H-isoindol-2-yl]propanoate |
|---|---|
| PubChem CID | 157362988 |
| Molecular Formula | C20H22ClN3O3 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | tert-butyl (2R)-2-[5-(5-chloro-2-methylpyrimidin-4-yl)-3-oxo-1H-isoindol-2-yl]propanoate |
| SMILES | Cc1ncc(Cl)c(-c2ccc3c(c2)C(=O)N([C@H](C)C(=O)OC(C)(C)C)C3)n1 |
| InChI | InChI=1S/C20H22ClN3O3/c1-11(19(26)27-20(3,4)5)24-10-14-7-6-13(8-15(14)18(24)25)17-16(21)9-22-12(2)23-17/h6-9,11H,10H2,1-5H3/t11-/m1/s1 |
| InChIKey | BVLHXMZWCMQFDX-LLVKDONJSA-N |
| XLogP | 3.79 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |