C31H58O8Si2 — CID 157363458
2-[(1S,2'S,3R,3'S,4'S,8R,10S,12R,14S)-6,6-ditert-butyl-4',14-dimethyl-3'-triethylsilyloxyspiro[2,5,7,11-tetraoxa-6-silatricyclo[8.4.0.03,8]tetradecane-12,6'-oxane]-2'-yl]acetic acid (PubChem CID 157363458) has the molecular formula C31H58O8Si2 and a molecular weight of 614.97 g/mol. Its IUPAC name is 2-[(1S,2'S,3R,3'S,4'S,8R,10S,12R,14S)-6,6-ditert-butyl-4',14-dimethyl-3'-triethylsilyloxyspiro[2,5,7,11-tetraoxa-6-silatricyclo[8.4.0.03,8]tetradecane-12,6'-oxane]-2'-yl]acetic acid.
| Compound Name | 2-[(1S,2'S,3R,3'S,4'S,8R,10S,12R,14S)-6,6-ditert-butyl-4',14-dimethyl-3'-triethylsilyloxyspiro[2,5,7,11-tetraoxa-6-silatricyclo[8.4.0.03,8]tetradecane-12,6'-oxane]-2'-yl]acetic acid |
|---|---|
| PubChem CID | 157363458 |
| Molecular Formula | C31H58O8Si2 |
| Molecular Weight | 614.97 g/mol |
| Exact Mass | 614.37 |
| IUPAC Name | 2-[(1S,2'S,3R,3'S,4'S,8R,10S,12R,14S)-6,6-ditert-butyl-4',14-dimethyl-3'-triethylsilyloxyspiro[2,5,7,11-tetraoxa-6-silatricyclo[8.4.0.03,8]tetradecane-12,6'-oxane]-2'-yl]acetic acid |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@H](CC(=O)O)O[C@]2(C[C@H](C)[C@@H]3O[C@@H]4CO[Si](C(C)(C)C)(C(C)(C)C)O[C@@H]4C[C@@H]3O2)C[C@@H]1C |
| InChI | InChI=1S/C31H58O8Si2/c1-12-40(13-2,14-3)39-28-21(5)18-31(37-24(28)16-26(32)33)17-20(4)27-23(36-31)15-22-25(35-27)19-34-41(38-22,29(6,7)8)30(9,10)11/h20-25,27-28H,12-19H2,1-11H3,(H,32,33)/t20-,21-,22+,23-,24-,25+,27-,28-,31+/m0/s1 |
| InChIKey | IHSZQAZXRJYEOU-MVFPIUABSA-N |
| XLogP | 7.01 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.97 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|