C33H35IrN2O3- — CID 157364437
4-(3H-dibenzofuran-3-id-4-yl)-7-(2-methylpropyl)quinazoline;5-hydroxy-2,6-dimethylhept-4-en-3-one;iridium (PubChem CID 157364437) has the molecular formula C33H35IrN2O3- and a molecular weight of 699.87 g/mol. Its IUPAC name is 4-(3H-dibenzofuran-3-id-4-yl)-7-(2-methylpropyl)quinazoline;5-hydroxy-2,6-dimethylhept-4-en-3-one;iridium.
| Compound Name | 4-(3H-dibenzofuran-3-id-4-yl)-7-(2-methylpropyl)quinazoline;5-hydroxy-2,6-dimethylhept-4-en-3-one;iridium |
|---|---|
| PubChem CID | 157364437 |
| Molecular Formula | C33H35IrN2O3- |
| Molecular Weight | 699.87 g/mol |
| Exact Mass | 700.23 |
| IUPAC Name | 4-(3H-dibenzofuran-3-id-4-yl)-7-(2-methylpropyl)quinazoline;5-hydroxy-2,6-dimethylhept-4-en-3-one;iridium |
| SMILES | CC(C)C(=O)C=C(O)C(C)C.CC(C)Cc1ccc2c(-c3[c-]ccc4c3oc3ccccc34)ncnc2c1.[Ir] |
| InChI | InChI=1S/C24H19N2O.C9H16O2.Ir/c1-15(2)12-16-10-11-19-21(13-16)25-14-26-23(19)20-8-5-7-18-17-6-3-4-9-22(17)27-24(18)20;1-6(2)8(10)5-9(11)7(3)4;/h3-7,9-11,13-15H,12H2,1-2H3;5-7,10H,1-4H3;/q-1;; |
| InChIKey | IPLPHGMUGWNASH-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.87 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|