About 3-(aminomethyl)pentan-2-one;1-(5-methylpiperidin-3-yl)ethanone;1-piperidin-3-ylethanone
3-(aminomethyl)pentan-2-one;1-(5-methylpiperidin-3-yl)ethanone;1-piperidin-3-ylethanone (PubChem CID 157366501) has the molecular formula C21H41N3O3
and a molecular weight of 383.58 g/mol. Its IUPAC name is 3-(aminomethyl)pentan-2-one;1-(5-methylpiperidin-3-yl)ethanone;1-piperidin-3-ylethanone.
Molecular Properties
| Compound Name | 3-(aminomethyl)pentan-2-one;1-(5-methylpiperidin-3-yl)ethanone;1-piperidin-3-ylethanone |
| PubChem CID | 157366501 |
| Molecular Formula | C21H41N3O3 |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.31 |
| IUPAC Name | 3-(aminomethyl)pentan-2-one;1-(5-methylpiperidin-3-yl)ethanone;1-piperidin-3-ylethanone |
| SMILES | CC(=O)C1CCCNC1.CC(=O)C1CNCC(C)C1.CCC(CN)C(C)=O |
| InChI | InChI=1S/C8H15NO.C7H13NO.C6H13NO/c1-6-3-8(7(2)10)5-9-4-6;1-6(9)7-3-2-4-8-5-7;1-3-6(4-7)5(2)8/h6,8-9H,3-5H2,1-2H3;7-8H,2-5H2,1H3;6H,3-4,7H2,1-2H3 |
| InChIKey | BJFYQXXBXXBCRQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(aminomethyl)pentan-2-one;1-(5-methylpiperidin-3-yl)ethanone;1-piperidin-3-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)pentan-2-one;1-(5-methylpiperidin-3-yl)ethanone;1-piperidin-3-ylethanone?
The IUPAC name of 3-(aminomethyl)pentan-2-one;1-(5-methylpiperidin-3-yl)ethanone;1-piperidin-3-ylethanone (CID 157366501) is 3-(aminomethyl)pentan-2-one;1-(5-methylpiperidin-3-yl)ethanone;1-piperidin-3-ylethanone.
What is the SMILES notation for 3-(aminomethyl)pentan-2-one;1-(5-methylpiperidin-3-yl)ethanone;1-piperidin-3-ylethanone?
The canonical SMILES for 3-(aminomethyl)pentan-2-one;1-(5-methylpiperidin-3-yl)ethanone;1-piperidin-3-ylethanone is CC(=O)C1CCCNC1.CC(=O)C1CNCC(C)C1.CCC(CN)C(C)=O.
What is the InChIKey of 3-(aminomethyl)pentan-2-one;1-(5-methylpiperidin-3-yl)ethanone;1-piperidin-3-ylethanone?
The InChIKey is BJFYQXXBXXBCRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO.C7H13NO.C6H13NO/c1-6-3-8(7(2)10)5-9-4-6;1-6(9)7-3-2-4-8-5-7;1-3-6(4-7)5(2)8/h6,8-9H,3-5H2,1-2H3;7-8H,2-5H2,1H3;6H,3-4,7H2,1-2H3.
What are the key properties of 3-(aminomethyl)pentan-2-one;1-(5-methylpiperidin-3-yl)ethanone;1-piperidin-3-ylethanone?
3-(aminomethyl)pentan-2-one;1-(5-methylpiperidin-3-yl)ethanone;1-piperidin-3-ylethanone has a molecular weight of 383.58 g/mol, XLogP of 1.96, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)pentan-2-one;1-(5-methylpiperidin-3-yl)ethanone;1-piperidin-3-ylethanone is sourced from PubChem (CID 157366501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).