methyl N-(3,4,5,6-tetramethyl-2-pyridinyl)carbamate

C11H16N2O2 — CID 157366725

IUPACmethyl N-(3,4,5,6-tetramethyl-2-pyridinyl)carbamate
SMILESCOC(=O)Nc1nc(C)c(C)c(C)c1C
InChIInChI=1S/C11H16N2O2/c1-6-7(2)9(4)12-10(8(6)3)13-11(14)15-5/h1-5H3,(H,12,13,14)
InChIKeyJDEIYRBJIKFPHJ-UHFFFAOYSA-N
MW208.26 g/mol
LogP2.49
Rot. Bonds1

About methyl N-(3,4,5,6-tetramethyl-2-pyridinyl)carbamate

methyl N-(3,4,5,6-tetramethyl-2-pyridinyl)carbamate (PubChem CID 157366725) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is methyl N-(3,4,5,6-tetramethyl-2-pyridinyl)carbamate.

Molecular Properties

Compound Namemethyl N-(3,4,5,6-tetramethyl-2-pyridinyl)carbamate
PubChem CID157366725
Molecular FormulaC11H16N2O2
Molecular Weight208.26 g/mol
Exact Mass208.12
IUPAC Namemethyl N-(3,4,5,6-tetramethyl-2-pyridinyl)carbamate
SMILESCOC(=O)Nc1nc(C)c(C)c(C)c1C
InChIInChI=1S/C11H16N2O2/c1-6-7(2)9(4)12-10(8(6)3)13-11(14)15-5/h1-5H3,(H,12,13,14)
InChIKeyJDEIYRBJIKFPHJ-UHFFFAOYSA-N
XLogP2.49
TPSA51.22 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.26
LogP ≤ 52.49
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl N-(3,4,5,6-tetramethyl-2-pyridinyl)carbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl N-(3,4,5,6-tetramethyl-2-pyridinyl)carbamate?
The IUPAC name of methyl N-(3,4,5,6-tetramethyl-2-pyridinyl)carbamate (CID 157366725) is methyl N-(3,4,5,6-tetramethyl-2-pyridinyl)carbamate.
What is the SMILES notation for methyl N-(3,4,5,6-tetramethyl-2-pyridinyl)carbamate?
The canonical SMILES for methyl N-(3,4,5,6-tetramethyl-2-pyridinyl)carbamate is COC(=O)Nc1nc(C)c(C)c(C)c1C.
What is the InChIKey of methyl N-(3,4,5,6-tetramethyl-2-pyridinyl)carbamate?
The InChIKey is JDEIYRBJIKFPHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O2/c1-6-7(2)9(4)12-10(8(6)3)13-11(14)15-5/h1-5H3,(H,12,13,14).
What are the key properties of methyl N-(3,4,5,6-tetramethyl-2-pyridinyl)carbamate?
methyl N-(3,4,5,6-tetramethyl-2-pyridinyl)carbamate has a molecular weight of 208.26 g/mol, XLogP of 2.49, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(3,4,5,6-tetramethyl-2-pyridinyl)carbamate is sourced from PubChem (CID 157366725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).