C22H18F3N5O — CID 157367657
5-[4-[[4-(3,4-difluorophenyl)-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]methyl]-2-fluorophenyl]-2-methyl-1,3-oxazole (PubChem CID 157367657) has the molecular formula C22H18F3N5O and a molecular weight of 425.41 g/mol. Its IUPAC name is 5-[4-[[4-(3,4-difluorophenyl)-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]methyl]-2-fluorophenyl]-2-methyl-1,3-oxazole.
| Compound Name | 5-[4-[[4-(3,4-difluorophenyl)-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]methyl]-2-fluorophenyl]-2-methyl-1,3-oxazole |
|---|---|
| PubChem CID | 157367657 |
| Molecular Formula | C22H18F3N5O |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 5-[4-[[4-(3,4-difluorophenyl)-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]methyl]-2-fluorophenyl]-2-methyl-1,3-oxazole |
| SMILES | Cc1ncc(-c2ccc(Cc3nc4n(n3)CCCN4c3ccc(F)c(F)c3)cc2F)o1 |
| InChI | InChI=1S/C22H18F3N5O/c1-13-26-12-20(31-13)16-5-3-14(9-18(16)24)10-21-27-22-29(7-2-8-30(22)28-21)15-4-6-17(23)19(25)11-15/h3-6,9,11-12H,2,7-8,10H2,1H3 |
| InChIKey | BJJMUCMPPBYOTJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 59.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |