C9H11Cl3N4O — CID 157367954
2-methyl-N-[2,2,3-trichloro-1-(1,2,4-triazol-1-yl)propyl]prop-2-enamide (PubChem CID 157367954) has the molecular formula C9H11Cl3N4O and a molecular weight of 297.57 g/mol. Its IUPAC name is 2-methyl-N-[2,2,3-trichloro-1-(1,2,4-triazol-1-yl)propyl]prop-2-enamide.
| Compound Name | 2-methyl-N-[2,2,3-trichloro-1-(1,2,4-triazol-1-yl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 157367954 |
| Molecular Formula | C9H11Cl3N4O |
| Molecular Weight | 297.57 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | 2-methyl-N-[2,2,3-trichloro-1-(1,2,4-triazol-1-yl)propyl]prop-2-enamide |
| SMILES | C=C(C)C(=O)NC(n1cncn1)C(Cl)(Cl)CCl |
| InChI | InChI=1S/C9H11Cl3N4O/c1-6(2)7(17)15-8(9(11,12)3-10)16-5-13-4-14-16/h4-5,8H,1,3H2,2H3,(H,15,17) |
| InChIKey | BJKJAANBEXJJGQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.57 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|