About 1-[(1S,2S)-2-fluorocyclopropyl]-3-(2-methylpropyl)pyridin-2-one
1-[(1S,2S)-2-fluorocyclopropyl]-3-(2-methylpropyl)pyridin-2-one (PubChem CID 157368115) has the molecular formula C12H16FNO
and a molecular weight of 209.26 g/mol. Its IUPAC name is 1-[(1S,2S)-2-fluorocyclopropyl]-3-(2-methylpropyl)pyridin-2-one.
Molecular Properties
| Compound Name | 1-[(1S,2S)-2-fluorocyclopropyl]-3-(2-methylpropyl)pyridin-2-one |
| PubChem CID | 157368115 |
| Molecular Formula | C12H16FNO |
| Molecular Weight | 209.26 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 1-[(1S,2S)-2-fluorocyclopropyl]-3-(2-methylpropyl)pyridin-2-one |
| SMILES | CC(C)Cc1cccn([C@H]2C[C@@H]2F)c1=O |
| InChI | InChI=1S/C12H16FNO/c1-8(2)6-9-4-3-5-14(12(9)15)11-7-10(11)13/h3-5,8,10-11H,6-7H2,1-2H3/t10-,11-/m0/s1 |
| InChIKey | SCUNDJDOOXIDHK-QWRGUYRKSA-N |
| XLogP | 2.33 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(1S,2S)-2-fluorocyclopropyl]-3-(2-methylpropyl)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S,2S)-2-fluorocyclopropyl]-3-(2-methylpropyl)pyridin-2-one?
The IUPAC name of 1-[(1S,2S)-2-fluorocyclopropyl]-3-(2-methylpropyl)pyridin-2-one (CID 157368115) is 1-[(1S,2S)-2-fluorocyclopropyl]-3-(2-methylpropyl)pyridin-2-one.
What is the SMILES notation for 1-[(1S,2S)-2-fluorocyclopropyl]-3-(2-methylpropyl)pyridin-2-one?
The canonical SMILES for 1-[(1S,2S)-2-fluorocyclopropyl]-3-(2-methylpropyl)pyridin-2-one is CC(C)Cc1cccn([C@H]2C[C@@H]2F)c1=O.
What is the InChIKey of 1-[(1S,2S)-2-fluorocyclopropyl]-3-(2-methylpropyl)pyridin-2-one?
The InChIKey is SCUNDJDOOXIDHK-QWRGUYRKSA-N. The full InChI is InChI=1S/C12H16FNO/c1-8(2)6-9-4-3-5-14(12(9)15)11-7-10(11)13/h3-5,8,10-11H,6-7H2,1-2H3/t10-,11-/m0/s1.
What are the key properties of 1-[(1S,2S)-2-fluorocyclopropyl]-3-(2-methylpropyl)pyridin-2-one?
1-[(1S,2S)-2-fluorocyclopropyl]-3-(2-methylpropyl)pyridin-2-one has a molecular weight of 209.26 g/mol, XLogP of 2.33, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S,2S)-2-fluorocyclopropyl]-3-(2-methylpropyl)pyridin-2-one is sourced from PubChem (CID 157368115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).